4-Propoxy-3-nitrobenzoic acid manufacturers
|
| | 4-Propoxy-3-nitrobenzoic acid Basic information |
| Product Name: | 4-Propoxy-3-nitrobenzoic acid | | Synonyms: | 4-Propoxy-3-nitrobenzoic acid;3-NITRO-4-PROPOXYBENZOIC ACID;Proparacaine Impurity 6;Benzoic acid, 3-nitro-4-propoxy-;Proparacaine Impurity 9;Proparacaine hydrochloride Impurity Q;Diphenhydramine Impurity 15;Pramecaine impurity 5 | | CAS: | 35288-44-9 | | MF: | C10H11NO5 | | MW: | 225.2 | | EINECS: | 233-305-4 | | Product Categories: | | | Mol File: | 35288-44-9.mol |  |
| | 4-Propoxy-3-nitrobenzoic acid Chemical Properties |
| Melting point | 167.5-169.7 °C | | Boiling point | 387.3±27.0 °C(Predicted) | | density | 1.318±0.06 g/cm3(Predicted) | | pka | 3.85±0.10(Predicted) | | InChI | InChI=1S/C10H11NO5/c1-2-5-16-9-4-3-7(10(12)13)6-8(9)11(14)15/h3-4,6H,2,5H2,1H3,(H,12,13) | | InChIKey | NKACWRJUOBYVGP-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(OCCC)C([N+]([O-])=O)=C1 |
| | 4-Propoxy-3-nitrobenzoic acid Usage And Synthesis |
| Uses |
4-Propoxy-3-nitrobenzoic acid is commonly used as an intermediate in the synthesis of proparacaine.
|
| | 4-Propoxy-3-nitrobenzoic acid Preparation Products And Raw materials |
|