| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3-Bromo-1-adamantaneacetic acid Basic information |
| | 3-Bromo-1-adamantaneacetic acid Chemical Properties |
| Melting point | 194-200 °C | | Boiling point | 373.3±15.0 °C(Predicted) | | density | 1.556±0.06 g/cm3(Predicted) | | form | solid | | pka | 4.72±0.10(Predicted) | | InChI | 1S/C12H17BrO2/c13-12-4-8-1-9(5-12)3-11(2-8,7-12)6-10(14)15/h8-9H,1-7H2,(H,14,15)/t8-,9+,11-,12- | | InChIKey | HFGLWCBEPPFDDJ-VSKBNFNDSA-N | | SMILES | OC(=O)C[C@]12C[C@H]3C[C@H](C[C@](Br)(C3)C1)C2 |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | 3-Bromo-1-adamantaneacetic acid Usage And Synthesis |
| | 3-Bromo-1-adamantaneacetic acid Preparation Products And Raw materials |
|