| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-Bromo-5-(trifluoromethoxy)toluene Basic information |
| | 2-Bromo-5-(trifluoromethoxy)toluene Chemical Properties |
| Boiling point | 197.9±35.0 °C(Predicted) | | density | 1.559 g/mL at 25 °C | | refractive index | n 20/D 1.469 | | Fp | 78 °C | | storage temp. | Sealed in dry,Room Temperature | | form | liquid | | color | Clear colourless | | InChI | InChI=1S/C8H6BrF3O/c1-5-4-6(2-3-7(5)9)13-8(10,11)12/h2-4H,1H3 | | InChIKey | ZKABPUGKDKWJIP-UHFFFAOYSA-N | | SMILES | C1(Br)=CC=C(OC(F)(F)F)C=C1C |
| Hazard Codes | Xi,N | | Risk Statements | 51/53 | | Safety Statements | 61 | | RIDADR | UN 3082 9/PG 3 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 2909309090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Aquatic Chronic 2 |
| | 2-Bromo-5-(trifluoromethoxy)toluene Usage And Synthesis |
| Uses | 1-Bromo-2-methyl-4-(trifluoromethoxy)benzene is used to prepare acetyl-CoA carboxylase inhibitors for metabolic syndrome treatment. |
| | 2-Bromo-5-(trifluoromethoxy)toluene Preparation Products And Raw materials |
|