| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 5-[4-(Methylthio)phenyl]thiophene-2-carboxylic acid Basic information |
| | 5-[4-(Methylthio)phenyl]thiophene-2-carboxylic acid Chemical Properties |
| Melting point | 220-224 °C(lit.) | | Boiling point | 447.5±40.0 °C(Predicted) | | density | 1.38±0.1 g/cm3(Predicted) | | form | solid | | pka | 3.51±0.10(Predicted) | | InChI | 1S/C12H10O2S2/c1-15-9-4-2-8(3-5-9)10-6-7-11(16-10)12(13)14/h2-7H,1H3,(H,13,14) | | InChIKey | XESWRPZAGPHDST-UHFFFAOYSA-N | | SMILES | CSc1ccc(cc1)-c2ccc(s2)C(O)=O |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 4 |
| | 5-[4-(Methylthio)phenyl]thiophene-2-carboxylic acid Usage And Synthesis |
| | 5-[4-(Methylthio)phenyl]thiophene-2-carboxylic acid Preparation Products And Raw materials |
|