| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
1,3-Benzodioxol-5-ol, 6-[4-morpholinyl[4-(trifluoromethyl)phenyl]methyl]- manufacturers
- RDR03785
-
- $30.00
-
2026-08-08
- CAS:289657-30-3
- Purity: 98.92%
- Supply Ability: 10g
|
| | 1,3-Benzodioxol-5-ol, 6-[4-morpholinyl[4-(trifluoromethyl)phenyl]methyl]- Basic information |
| | 1,3-Benzodioxol-5-ol, 6-[4-morpholinyl[4-(trifluoromethyl)phenyl]methyl]- Chemical Properties |
| Boiling point | 468.7±45.0 °C(Predicted) | | density | 1.392±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: 50mg/mL, clear, colorless | | form | Solid | | pka | 9.68±0.20(Predicted) | | color | White to off-white | | SMILES | C1COCCN1C(C2=CC=C(C=C2)C(F)(F)F)C3=CC4=C(C=C3O)OCO4 |
| WGK Germany | WGK 2 | | Storage Class | 11 - Combustible Solids |
| | 1,3-Benzodioxol-5-ol, 6-[4-morpholinyl[4-(trifluoromethyl)phenyl]methyl]- Usage And Synthesis |
| Uses | RDR 03785 is a covalent MIF inhibitor with an IC50 of 0.36 μM[1]. | | References | [1] Cisneros JA, et al. Irregularities in enzyme assays: The case of macrophage migration inhibitory factor. Bioorg Med Chem Lett. 2016 Jun 15;26(12):2764-2767. DOI:10.1016/j.bmcl.2016.04.074 |
| | 1,3-Benzodioxol-5-ol, 6-[4-morpholinyl[4-(trifluoromethyl)phenyl]methyl]- Preparation Products And Raw materials |
|