|
|
| | 4-Fluoro-3-(trifluoromethyl)aniline Basic information |
| Product Name: | 4-Fluoro-3-(trifluoromethyl)aniline | | Synonyms: | α,α,α,4-Tetrafluoro-m-toluidine;5-Amino-2-fluorobenzotrifluoride, α,α,α,4-Tetrafluoro-m-toluidine;Benzenamine, 4-fluoro-3-(trifluoromethyl)-;4-Fluoro-3-(trifluoromethyl)-1-benzenamine;alpha,alpha,alpha,4-Tetrafluoro-m-toluidine,99%;2-Fluoro-2-aminobenzotrifluoride;4-Fluoro-3-trifluoromethyl-phenylamine;2-Fluoro-5-Aminotrifluoromethylbenzene | | CAS: | 2357-47-3 | | MF: | C7H5F4N | | MW: | 179.11 | | EINECS: | 219-095-7 | | Product Categories: | Fluorobenzene;Anilines, Aromatic Amines and Nitro Compounds;Aromatic Halides (substituted);Aniline;API intermediates;Amines;blocks;FluoroCompounds;Miscellaneous;Trifluoromethylbenzene serise | | Mol File: | 2357-47-3.mol |  |
| | 4-Fluoro-3-(trifluoromethyl)aniline Chemical Properties |
| Boiling point | 207-208 °C (lit.) | | density | 1.393 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.466(lit.) | | Fp | 197 °F | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | pka | 3.43±0.10(Predicted) | | color | Colourless | | Specific Gravity | 1.41 | | BRN | 641587 | | InChI | InChI=1S/C7H5F4N/c8-6-2-1-4(12)3-5(6)7(9,10)11/h1-3H,12H2 | | InChIKey | PGFQDLOMDIBAPY-UHFFFAOYSA-N | | SMILES | C1(N)=CC=C(F)C(C(F)(F)F)=C1 | | CAS DataBase Reference | 2357-47-3(CAS DataBase Reference) | | NIST Chemistry Reference | Benzenamine, 4-fluoro-3-(trifluoromethyl)-(2357-47-3) |
| Hazard Codes | Xn,Xi,T | | Risk Statements | 20/21/22-36/37/38-23-21/22 | | Safety Statements | 26-36-45-36/37/39 | | RIDADR | 2811 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 6.1 | | HS Code | 29214300 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4-Fluoro-3-(trifluoromethyl)aniline Usage And Synthesis |
| Chemical Properties | clear yellow to brown-red liquid | | Uses | 4-Fluoro-3-(trifluoromethyl)aniline was used in the synthesis of well-defined rod-coil block copolymers of trifluoromethylated poly(phenylene oxide). |
| | 4-Fluoro-3-(trifluoromethyl)aniline Preparation Products And Raw materials |
|