- benzo(c)fluorene
-
- $200.00
-
2026-09-02
- CAS:205-12-9
- Min. Order: 1KG
- Purity: 99%, 99.5% Sublimated
- BENZO(C)FLUORENE
-
- $1.00
-
2020-02-01
- CAS:205-12-9
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 200kgs
|
| | Benzo(c)fluorene Basic information |
| Product Name: | Benzo(c)fluorene | | Synonyms: | 3,4-benzofluorene;7H-benzo[c]fluorine;NSC 89264;benzo(c)fluorene<7h-benzo(c)fluorene;BENZO[C]FLUORINE;7H-Benzo[c]fluorene 10.0 μg/ml Cyclohexane;C20590400 7H-Benzo[c]fluorene;L20590400CY 7H-Benzo[c]fluorenE10μg/mLin Cyc | | CAS: | 205-12-9 | | MF: | C17H12 | | MW: | 216.28 | | EINECS: | 205-908-2 | | Product Categories: | | | Mol File: | 205-12-9.mol |  |
| | Benzo(c)fluorene Chemical Properties |
| Melting point | 125-127℃ | | Boiling point | 398℃ | | density | 1.185 | | refractive index | 1.6000 (estimate) | | Fp | 185℃ | | storage temp. | Amber Vial, -20°C Freezer, Under inert atmosphere | | solubility | Chloroform (Slightly), Methanol (Slightly, Heated) | | form | Solid | | color | White to Off-White | | Stability: | Light Sensitive | | InChI | InChI=1S/C17H12/c1-3-7-15-12(5-1)9-10-14-11-13-6-2-4-8-16(13)17(14)15/h1-10H,11H2 | | InChIKey | FRIJWEQBTIZQMD-UHFFFAOYSA-N | | SMILES | C1C2=C(C=CC=C2)C2=C1C=CC1=CC=CC=C12 | | IARC | 3 (Vol. 92, Sup 7) 2010 |
| RIDADR | 2811 | | HazardClass | 6.1(b) | | PackingGroup | III |
| | Benzo(c)fluorene Usage And Synthesis |
| Chemical Properties | Plates from ethanol. | | Uses | 7H-Benzo[c]fluorene is a polycyclic aomatic hydrocarbon (PAH) with mutagenic activity. 7H-Benzo[c]fluorene is a major DNA adduct-forming component of coal tar. Recent studies suggest that 7H-Benzo[c]f
luorene may be capable of inducing lung tumors. | | Definition | ChEBI: Benzo[c]fluorene is a carbotetracyclic compound. | | Safety Profile | Questionable carcinogen. Whenheated to decomposition it emits acrid smoke andirritating vapors. | | Carcinogenicity | Benzo[c]fluorene gave negative
results in repeated application and two-stage skin carcinogenesis
tests but positive results by oral and interperitoneal
administration in mice. |
| | Benzo(c)fluorene Preparation Products And Raw materials |
|