- Pirodavir
-
- $59.00
-
2026-05-11
- CAS:124436-59-5
- Purity: 98.43%
- Supply Ability: 10g
- pirodavir USP/EP/BP
-
- $1.10
-
2025-11-18
- CAS:124436-59-5
- Min. Order: 1g
- Purity: 99.9%
- Supply Ability: 100 Tons Min
- pirodavir
-
- $15.00
-
2021-07-13
- CAS:124436-59-5
- Min. Order: 1KG
- Purity: 99%+ HPLC
|
| | pirodavir Basic information |
| Product Name: | pirodavir | | Synonyms: | pirodavir;Pirodavir, >=99%;Ethyl 4-(2-(1-(6-methylpyridazin-3-yl)piperidin-4-yl)ethoxy)benzoate;Ethyl p-[2-[1-(6-Methylpyridazin-3-yl)piperidin-4-yl]-ethoxy]benzoate;Benzoic acid, 4-[2-[1-(6-Methyl-3-pyridazinyl)-4-piperidinyl]ethoxy]-, ethyl ester;ethyl p-(2-(1-(6-Methyl-3-pyridazinyl)-4-piperidyl)ethoxy) benzoate;R 77975;R77975 | | CAS: | 124436-59-5 | | MF: | C21H27N3O3 | | MW: | 369.46 | | EINECS: | | | Product Categories: | Inhibitors | | Mol File: | 124436-59-5.mol |  |
| | pirodavir Chemical Properties |
| Melting point | 124-125℃ | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | Off-White to Pale Beige | | InChI | 1S/C21H27N3O3/c1-3-26-21(25)18-5-7-19(8-6-18)27-15-12-17-10-13-24(14-11-17)20-9-4-16(2)22-23-20/h4-9,17H,3,10-15H2,1-2H3 | | InChIKey | KCHIOGFOPPOUJC-UHFFFAOYSA-N | | SMILES | O=C(OCC)C1=CC=C(OCCC2CCN(C3=NN=C(C)C=C3)CC2)C=C1 |
| WGK Germany | WGK 3 | | HS Code | 2933.99.7500 | | Storage Class | 11 - Combustible Solids |
| | pirodavir Usage And Synthesis |
| Description | Pirodavir is a broad-spectrum antipicornaviral agent. It is active against 80 typed (MICs = 0.001-14.4 μg/ml) and one untyped rhinovirus strain (MIC = 0.002 μg/ml) and is active against both group A and group B serotypes. It is also active against serotypes of coxsackievirus, poliovirus, and echovirus enteroviruses (MICs = 0.018-8.5, 0.025-0.27, and 0.019-1.3 μg/ml, respectively). | | Uses | Pirodavir is used to modulate lipophilicity in human rhinovirus capsid binders. It also is used in order to identify potential ativiral agents. | | Uses | R 77975 is used to modulate lipophilicity in human rhinovirus capsid binders. It also is used in order to identify potential ativiral agents. | | References | [1] K ANDRIES. In vitro activity of pirodavir (R 77975), a substituted phenoxy-pyridazinamine with broad-spectrum antipicornaviral activity.[J]. Antimicrobial Agents and Chemotherapy, 1992, 36 1: 100-107. DOI: 10.1128/aac.36.1.100 |
| | pirodavir Preparation Products And Raw materials |
|