|
|
| | 2'-(Trifluoromethyl)propiophenone Basic information |
| | 2'-(Trifluoromethyl)propiophenone Chemical Properties |
| Boiling point | 219-220 °C(lit.) | | density | 1.214 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.461(lit.) | | Fp | 214 °F | | storage temp. | Sealed in dry,Room Temperature | | Specific Gravity | 1.214 | | Appearance | Colorless to light yellow Liquid | | BRN | 2263292 | | InChI | InChI=1S/C10H9F3O/c1-2-9(14)7-5-3-4-6-8(7)10(11,12)13/h3-6H,2H2,1H3 | | InChIKey | PUSBIOFSWWHNDD-UHFFFAOYSA-N | | SMILES | C(C1=CC=CC=C1C(F)(F)F)(=O)CC | | CAS DataBase Reference | 16185-96-9(CAS DataBase Reference) | | NIST Chemistry Reference | 2-(Trifluoromethyl)propiophenone(16185-96-9) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29147000 | | Storage Class | 10 - Combustible liquids |
| | 2'-(Trifluoromethyl)propiophenone Usage And Synthesis |
| | 2'-(Trifluoromethyl)propiophenone Preparation Products And Raw materials |
|