| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | (2R,4R)-1-tert-Butyl 2-methyl 4-hydroxypyrrolidine-1,2-dicarboxylate Basic information |
| Product Name: | (2R,4R)-1-tert-Butyl 2-methyl 4-hydroxypyrrolidine-1,2-dicarboxylate | | Synonyms: | (2R,4R)-4-Hydroxy-1,2-pyrrolidinedicarboxylicacid 1-(1,1-dimethylethyl) 2-methyl ester;(2R,4R)-1-tert-butyl 2-Methyl 4-hydroxypyrrolidine-1,2-dicarboxy;(2R,4R)-1-tert-butyl 2-Methyl 4-hydro×ypyrrolidine-1,2-dicarbo×ylate;Boc-Cis-D-Hyp-OMe;Methy cis-1-Boc-4-hydroxy-D-prolinate;Methyl cis-Boc-4-hydroxy-D-prolinate;1,2-Pyrrolidinedicarboxylic acid, 4-hydroxy-, 1-(1,1-dimethylethyl) 2-methyl ester, (2R,4R)-;1-tert-butyl 2-methyl (2R,4R)-4-hydroxypyrrolidine-1,2-dicarboxylate | | CAS: | 114676-69-6 | | MF: | C11H19NO5 | | MW: | 245.27 | | EINECS: | 675-952-9 | | Product Categories: | | | Mol File: | 114676-69-6.mol |  |
| | (2R,4R)-1-tert-Butyl 2-methyl 4-hydroxypyrrolidine-1,2-dicarboxylate Chemical Properties |
| Melting point | 76 °C | | Boiling point | 335.2±42.0 °C(Predicted) | | alpha | 63° (C=1,EtOH) | | density | 1.216±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | pka | 14.27±0.40(Predicted) | | form | Powder | | color | White | | InChI | InChI=1S/C11H19NO5/c1-11(2,3)17-10(15)12-6-7(13)5-8(12)9(14)16-4/h7-8,13H,5-6H2,1-4H3/t7-,8-/m1/s1 | | InChIKey | MZMNEDXVUJLQAF-HTQZYQBOSA-N | | SMILES | N1(C(OC(C)(C)C)=O)C[C@H](O)C[C@@H]1C(OC)=O |
| | (2R,4R)-1-tert-Butyl 2-methyl 4-hydroxypyrrolidine-1,2-dicarboxylate Usage And Synthesis |
| Uses | (2R,4R)-1-tert-Butyl 2-methyl 4-hydroxypyrrolidine-1,2-dicarboxylate (N-Boc-cis-4-hydroxy-D-proline methyl ester) is a non-cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). (2R,4R)-1-tert-Butyl 2-methyl 4-hydroxypyrrolidine-1,2-dicarboxylate is also a alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs. | | IC 50 | Non-cleavable Linker |
| | (2R,4R)-1-tert-Butyl 2-methyl 4-hydroxypyrrolidine-1,2-dicarboxylate Preparation Products And Raw materials |
| Preparation Products | 1-Pyrrolidinecarboxylicacid,4-amino-2-methyl-,1,1-dimethylethylester,(2S-trans)-(9CI)-->Methyl (R)-1-Boc-4,4-difluoropyrrolidine-2-carboxylate-->1,2-Pyrrolidinedicarboxylic acid, 4-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-, 1-(1,1-dimethylethyl) 2-methyl ester, (2R,4R)- |
|