Ethyl N-[(2-Boc-amino)ethyl]glycinate hydrochloride manufacturers
|
| | Ethyl N-[(2-Boc-amino)ethyl]glycinate hydrochloride Basic information |
| Product Name: | Ethyl N-[(2-Boc-amino)ethyl]glycinate hydrochloride | | Synonyms: | Ethyln-(Bocaminoethyl)Glycinatehcl;Ethyl N-(Boc-aMinoethyl)glycinate hydrochloride;Ethyl 2-((2-((tert-butoxycarbonyl)aMino)ethyl)aMino)acetate hydrochloride;Glycine, N-[2-[[(1,1-dimethylethoxy)carbonyl]amino]ethyl]-, ethyl ester, hydrochloride (1:1);ethyl N-{2-[(tert-butoxycarbonyl)amino]ethyl}glycinate hydrochloride;2-[2-[[(2-methylpropan-2-yl)oxy-oxomethyl]amino]ethylamino]acetic acid ethyl ester hydrochloride;Boc-Aeg-OEt.HCl;ethyl2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]acetate,hydrochloride | | CAS: | 347890-34-0 | | MF: | C11H22N2O4HCl | | MW: | 0 | | EINECS: | | | Product Categories: | | | Mol File: | 347890-34-0.mol | ![Ethyl N-[(2-Boc-amino)ethyl]glycinate hydrochloride Structure](CAS/GIF/347890-34-0.gif) |
| | Ethyl N-[(2-Boc-amino)ethyl]glycinate hydrochloride Chemical Properties |
| storage temp. | -20°C | | form | Solid | | color | White to off-white | | BRN | 5814030 | | Major Application | peptide synthesis | | InChI | 1S/C11H22N2O4.ClH/c1-5-16-9(14)8-12-6-7-13-10(15)17-11(2,3)4;/h12H,5-8H2,1-4H3,(H,13,15);1H | | InChIKey | CZTZMHQGYIOSNM-UHFFFAOYSA-N | | SMILES | Cl[H].CCOC(=O)CNCCNC(=O)OC(C)(C)C |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Ethyl N-[(2-Boc-amino)ethyl]glycinate hydrochloride Usage And Synthesis |
| Uses | Ethyl N-[(2-Boc-amino)ethyl]glycinate, HCl | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | Ethyl N-[(2-Boc-amino)ethyl]glycinate hydrochloride Preparation Products And Raw materials |
|