- DEAE-cellulose
-
- $5.00 / 1KG
-
2025-05-26
- CAS:9013-34-7
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10000kg
|
| | DEAE-cellulose Basic information |
| Product Name: | DEAE-cellulose | | Synonyms: | Cellulose,2-(diethylamino)ethylether;DIETHYLAMINOETHYL CELLULOSE;DIETHYLAMINOETHYL SEPHACEL;DEAE 23 SH-CELLULOSE;DEAE 23 SS-CELLULOSE;DEAE 52-CELLULOSE;DEAE CELLULOSE;DEAE-CELLULOSE SH | | CAS: | 9013-34-7 | | MF: | C20H23NO5 | | MW: | 0 | | EINECS: | | | Product Categories: | AMEKO;Chromatography Media | | Mol File: | Mol File | ![DEAE-cellulose Structure]() |
| | DEAE-cellulose Chemical Properties |
| Fp | 36 °C | | storage temp. | Refrigerator | | form | preswollen, microgranular | | color | Off-White to Light Grey | | PH | 2—12 | | Cosmetics Ingredients Functions | ABSORBENT | | InChI | 1S/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3?,4?,5?,6?,7?,8?,9?,10-,11?,12+/m1/s1 | | InChIKey | GUBGYTABKSRVRQ-WFVLMXAXSA-N | | SMILES | OC[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@H](O)[C@@H](O)O[C@H]2CO)[C@@H](O)[C@H](O)[C@H]1O | | EPA Substance Registry System | Cellulose, 2-(diethylamino)ethyl ether (9013-34-7) |
| Hazard Codes | Xi,Xn | | Risk Statements | 10-36/37/38-20/21/22 | | Safety Statements | 26-36-37/39 | | RIDADR | UN 1170 3/PG 3 | | WGK Germany | 3 | | F | 3 | | TSCA | TSCA listed | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 3 |
| | DEAE-cellulose Usage And Synthesis |
| Chemical Properties | cation exchange resin capacity ~1 meq/g | | Uses | A cellulose Ion-exchange adsorbent | | General Description | DEAE-cellulose is a particle-type hydrophilic polymer with an average particle size of 50um, and the surface is branched with macromolecular sugar chains, so that it has a higher specific surface area and better biocompatibility, high loading, and at the same time. With better resolution, it is used to separate biopolymers. |
| | DEAE-cellulose Preparation Products And Raw materials |
|