| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
Diphenyl(pentafluorophenyl)phosphine manufacturers
|
| | Diphenyl(pentafluorophenyl)phosphine Basic information |
| Product Name: | Diphenyl(pentafluorophenyl)phosphine | | Synonyms: | DIPHENYL(PENTAFLUOROPHENYL)PHOSPHINE, 96 %;Pentafluorophenyldiphenylphosphine,98%;Diphenyl(pentafluorophenyl)phosphine 98%;Diphenyl(pentafluorophenyl)phosphine98%;(2,3,4,5,6-pentafluorophenyl)(diphenyl)phosphine;1-(Diphenylphosphino)-2,3,4,5,6-pentafluorobenzene;difluoro-diphenyl-(2,3,4-trifluorophenyl)phosphorane;4-(8-Hydroxy-5-quinolylazo)-1-naphthalenesulfonicAcidDisodiumSalt> | | CAS: | 5525-95-1 | | MF: | C18H10F5P | | MW: | 352.24 | | EINECS: | | | Product Categories: | Phosphine Ligands;Synthetic Organic Chemistry;Ligand | | Mol File: | 5525-95-1.mol |  |
| | Diphenyl(pentafluorophenyl)phosphine Chemical Properties |
| Melting point | 71-72 °C(lit.) | | Boiling point | 353.7±42.0 °C(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | soluble in Chloroform | | form | solid | | color | White to Almost white | | InChI | InChI=1S/C18H10F5P/c19-13-14(20)16(22)18(17(23)15(13)21)24(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H | | InChIKey | KUTXTUCJQJPJBH-UHFFFAOYSA-N | | SMILES | P(C1=C(F)C(F)=C(F)C(F)=C1F)(C1=CC=CC=C1)C1=CC=CC=C1 | | CAS DataBase Reference | 5525-95-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29310099 |
| | Diphenyl(pentafluorophenyl)phosphine Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | The reaction of (pentafluorophenyl)diphenylphosphine with C-ethoxycarbonyl-(p-methoxyphenyl) nitrile imine was used to synthesize [2,3,4,5-tetrafluoro-6-(p- methoxyphenylamino)phenyl]diphenylphosphine oxide whose reduction with trichlorosilane. the reactions of (pentafluorophenyl)diphenylphosphine and bis(penta- fluorophenyl)(phenyl)phosphine with nitrilimines (Housgen 1,3-dipoles) involves two-stage cycloaddi- tion and leads to formation of sufficiently stable fluorophosphoranes. |
| | Diphenyl(pentafluorophenyl)phosphine Preparation Products And Raw materials |
|