Acetaminophen glucuronide sodium salt manufacturers
|
| | Acetaminophen glucuronide sodium salt Basic information |
| | Acetaminophen glucuronide sodium salt Chemical Properties |
| Melting point | 232-233°C (dec) | | storage temp. | −20°C | | solubility | Methanol (Slightly), Water (Slightly) | | form | Solid | | color | White to Off-White | | Water Solubility | water: 25mg/mL, clear, colorless to light yellow | | Stability: | Hygroscopic | | InChIKey | OINXIJJEOMGKPB-CYRSAHDMSA-M | | SMILES | [Na+].CC(=O)Nc1ccc(O[C@@H]2O[C@@H]([C@@H](O)[C@H](O)[C@H]2O)C([O-])=O)cc1 | | CAS DataBase Reference | 120595-80-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | WGK Germany | 3 | | HS Code | 29329990 | | Storage Class | 11 - Combustible Solids |
| | Acetaminophen glucuronide sodium salt Usage And Synthesis |
| Chemical Properties | Off-White Cyrstalline Solid | | Uses | The major urinary metabolite of Acetaminophen (A161220) in man. | | Uses | The major urinary metabolite of Acetaminophen (A161220) (Paracetamol) in man. | | Uses | The major urinary metabolite of acetaminophen in man |
| | Acetaminophen glucuronide sodium salt Preparation Products And Raw materials |
|