| Company Name: |
Hubei Co-Formula Material Tech Co., Ltd. |
| Tel: |
+86-27-84459282 |
| Email: |
sales@cfmats.com |
| Products Intro: |
Product Name:2,4,6,8,10-pentamethyl-1,3,5,7,9,2λ3,4λ3,6λ3,8λ3,10λ3-pentaoxapentasilecane CAS:6166-86-5 Package:10ML~1000L
|
|
|
|
|
|
| | PENTAMETHYLCYCLOPENTASILOXANE Basic information |
| Product Name: | PENTAMETHYLCYCLOPENTASILOXANE | | Synonyms: | 2,4,6,8,10-pentamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane;2,4,6,8,10-pentamethyl-1,3,5,7,9,2λ3,4λ3,6λ3,8λ3,10λ3-pentaoxapentasilecane;2,4,6,8,10-PENTAMETHYLCYCLOPENTASILOXANE;PENTAMETHYLCYCLOPENTASILOXANE;PENTAMETHYLCYCLOPENTASILOXANE CONTAINS OTHER CYCLIC HOMOLOGS;2,4,6 8,10-PENTAMETHYLCYCLOPENTASILOXANE TECH 90+%;PENTAMETHYLCYCLOPENTASILOXANE: 90% CONTAINS OTHER CYCLIC HOMOLOGS;2,4,6,8,10-Pentamethylcyclodecanepentasiloxane | | CAS: | 6166-86-5 | | MF: | C5H20O5Si5 | | MW: | 300.64 | | EINECS: | 228-204-7 | | Product Categories: | Organometallic Reagents;SiliconOrganometallic Reagents;Organosilicon;Precursors by Metal;Siloxanes;Vapor Deposition Precursors;Chemical Synthesis;CVD and ALD Precursors by Metal;Materials Science;Micro/NanoElectronics;Organometallic Reagents;Silicon;Vapor Deposition Precursors | | Mol File: | 6166-86-5.mol |  |
| | PENTAMETHYLCYCLOPENTASILOXANE Chemical Properties |
| Melting point | -108°C | | Boiling point | 54 °C/10 mmHg (lit.) | | density | 0.992 g/mL at 25 °C (lit.) | | vapor pressure | 0.05-91Pa at 20℃ | | refractive index | n20/D 1.392(lit.) | | Fp | 39°C | | storage temp. | 2-8°C | | form | liquid | | Specific Gravity | 0.998 | | Water Solubility | 110-1000000000μg/L at 20℃ | | Hydrolytic Sensitivity | 3: reacts with aqueous base | | BRN | 1792134 | | InChI | 1S/C5H20O5Si5/c1-11-6-12(2)8-14(4)10-15(5)9-13(3)7-11/h11-15H,1-5H3 | | InChIKey | HGPDWMTUQRNTQT-UHFFFAOYSA-N | | SMILES | C[SiH]1O[SiH](C)O[SiH](C)O[SiH](C)O[SiH](C)O1 | | LogP | -2.4-6.33 at 20℃ | | EPA Substance Registry System | Cyclopentasiloxane, 2,4,6,8,10-pentamethyl- (6166-86-5) |
| Hazard Codes | Xi | | Risk Statements | 10-36/37/38 | | Safety Statements | 16-26-36 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 3 | | F | 10-21 | | TSCA | TSCA listed | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 3 |
| | PENTAMETHYLCYCLOPENTASILOXANE Usage And Synthesis |
| Uses | 2,4,6,8,10-Pentamethylcyclopentasiloxane is an active reagent in the preparation of cyclolinear polysiloxanes and in the preparation of novel class of hybrid polyurethanes. | | Flammability and Explosibility | Flammable | | Toxics Screening Level | The ITSL for cyclic methylhydrogensiloxane, d5 has been changed from 0.04 μg/m3 to 0.1 μg/m3 based on annual averaging time. |
| | PENTAMETHYLCYCLOPENTASILOXANE Preparation Products And Raw materials |
| Raw materials | Dichloromethylsilane | | Preparation Products | 1,1,1,3,5,5,5-Heptamethyltrisiloxane-->2,4,6,8-Tetramethylcyclotetrasiloxane-->2 4 6-TRIMETHYLCYCLOTRISILOXANE 99-->1,3-BIS(TRIMETHYLSILOXY)-1,3-DIMETHYLDISILOXANE |
|