| Company Name: |
Energy Chemical Gold |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | Ethylene glycol Basic information |
| | Ethylene glycol Chemical Properties |
| Melting point | −13 °C(lit.) | | Boiling point | 196-198 °C(lit.) | | density | 1.113 g/mL at 25 °C(lit.) | | vapor density | 2.1 (vs air) | | vapor pressure | 0.08 mm Hg ( 20 °C) | | refractive index | n20/D 1.431(lit.) | | Fp | >230 °F | | storage temp. | 2-8°C | | solubility | Warer (Slightly) | | form | Liquid | | pka | 14.126±0.10(predicted) | | color | blue | | Water Solubility | Soluble in water, methanol, DMSO | | Dielectric constant | 37.7(25℃) | | Stability: | Hygroscopic | | InChI | 1S/C2H6O2/c3-1-2-4/h3-4H,1-2H2/i1D2,2D2,3D,4D | | InChIKey | LYCAIKOWRPUZTN-UFSLNRCZSA-N | | SMILES | [2H]OC([2H])([2H])C([2H])([2H])O[2H] | | CAS DataBase Reference | 15054-86-1(CAS DataBase Reference) | | CAS Number Unlabeled | 107-21-1 |
| Hazard Codes | Xn | | Risk Statements | 22-36 | | Safety Statements | 26-36-24/25 | | RIDADR | UN 3082 9 / PGIII | | WGK Germany | 1 | | RTECS | KW2975000 | | F | 3 | | HS Code | 28459000 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral
STOT RE 2 Oral |
| | Ethylene glycol Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Uses | Ethylene glycol-d6 may be used as starting material for the synthesis of oxiran-d4. | | General Description | Ethylene glycol-d6 is a deuterated NMR solvent useful in NMR-based research and analyses. Its infrared spectrum has been recorded. |
| | Ethylene glycol Preparation Products And Raw materials |
|