|
|
| | ETHYLENE-D4 GLYCOL Basic information |
| | ETHYLENE-D4 GLYCOL Chemical Properties |
| Melting point | -13 °C (lit.) | | Boiling point | 196-198 °C (lit.) | | density | 1.184 g/mL at 25 °C | | refractive index | n20/D 1.428(lit.) | | Fp | >230 °F | | storage temp. | Refrigerator | | solubility | Chloroform (Soluble), Methanol (Slightly) | | form | Colourless Liquid | | color | Colorless to light yellow | | InChI | 1S/C2H6O2/c3-1-2-4/h3-4H,1-2H2/i1D2,2D2 | | InChIKey | LYCAIKOWRPUZTN-LNLMKGTHSA-N | | SMILES | [2H]C([2H])(O)C([2H])([2H])O | | CAS Number Unlabeled | 107-21-1 |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 2 | | RIDADR | UN 3082 9 / PGIII | | WGK Germany | 3 | | HazardClass | 9 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral
STOT RE 2 Oral |
| Provider | Language |
|
ACROS
| English |
| | ETHYLENE-D4 GLYCOL Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Uses | Ethylene-d4 Glycol is the isotope labelled analog of Ethylene Glycol (E917520), an organic compound widely used as an automotive antifreeze and a precursor to polymers. | | Uses | Ethylene-d4 Glycol is the isotope labelled analog of Ethylene Glycol , an organic compound widely used as an automotive antifreeze and a precursor to polymers. | | Uses | Isotope labelled Ethylene Glycol (E890140), an organic compound widely used as an automotive antifreeze (1) and a precursor to labelled polymers (2) and polymer-grafted membranes (3). Drinking water contaminant candidate list 3 (CCL 3) compound as per United States Environmental Protection Agency (EPA), environmental, and food contaminants. | | General Description | Ethylene-d4 glycol is a deuterated NMR solvent that is useful in NMR-based research and analyses. |
| | ETHYLENE-D4 GLYCOL Preparation Products And Raw materials |
|