|
|
| | (3S,4S)-N-Boc-3-amino-4-hydroxypyrrolidine Basic information |
| Product Name: | (3S,4S)-N-Boc-3-amino-4-hydroxypyrrolidine | | Synonyms: | (3s,4s)-n-boc-3-amino-4-hydroxypyrrolidine;1-Pyrrolidinecarboxylicacid,3-amino-4-hydroxy-,1,1-dimethylethylester,(3S,4S)-(9CI);(3S,4S)-3-Amino-4-hydroxypyrrolidine-1-carboxylic acid tert-butyl ester;1-Boc-(3S,4S)-3-aMino-4-hydroxypyrrolidine;(3S,4S)-4-aMino-1-N-tert-butyloxycarbonyl-3-hydroxypyrrolidine;(3S,4S)-N-Boc-4-hydroxypyrrolidine;Trans-(3S,4S)-1-Boc-3-aMino-4-hydroxypyrrolidine;tert-Butyl (3R,4R)-3-amino-4-hydroxypyrrolidine-1-carboxylate 97% | | CAS: | 190792-74-6 | | MF: | C9H18N2O3 | | MW: | 202.25 | | EINECS: | | | Product Categories: | AMINOACID | | Mol File: | 190792-74-6.mol |  |
| | (3S,4S)-N-Boc-3-amino-4-hydroxypyrrolidine Chemical Properties |
| Boiling point | 308.8±42.0 °C(Predicted) | | density | 1.179 | | storage temp. | 2-8°C(protect from light) | | pka | 14.36±0.40(Predicted) | | Appearance | White to off-white Solid | | Optical Rotation | 2.4° (C=0.01 g/ml, ETOH) | | InChI | InChI=1S/C9H18N2O3/c1-9(2,3)14-8(13)11-4-6(10)7(12)5-11/h6-7,12H,4-5,10H2,1-3H3/t6-,7-/m0/s1 | | InChIKey | MOZOQDNRVPHFOO-BQBZGAKWSA-N | | SMILES | N1(C(OC(C)(C)C)=O)C[C@H](O)[C@@H](N)C1 |
| | (3S,4S)-N-Boc-3-amino-4-hydroxypyrrolidine Usage And Synthesis |
| Uses | (3S,4S)-N-Boc-3-amino-4-hydroxypyrrolidine is used as a pharmaceutical intermediate. | | Synthesis | General procedure for the synthesis of 1-Boc-(3S,4S)-3-amino-4-hydroxypyrrolidine from the compound (CAS:1202067-33-1): trifluoroacetic acid (TFA, 3 drops) was added to a methanol (50 mL) solution of Intermediate 11 (5.1 g, 17.1 mmol) and the mixture was stirred for 2 hours. Subsequently, platinum oxide (100 mg, 0.44 mmol) was added to the mixture and stirred under hydrogen atmosphere for 18 hours. After completion of the reaction, the mixture was filtered through diatomaceous earth and the solvent was removed by vacuum evaporation. The crude product was recrystallized by dichloromethane (DCM) to afford 1-Boc-(3S,4S)-3-amino-4-hydroxypyrrolidine as a white solid (2.42 g, 71% yield). NMR hydrogen spectral (CDCl3) data: δ 3.99 (1H, m), 3.70 (2H, m), 3.34 (2H, m), 3.12 (1H, m), 1.48 (9H, s). | | References | [1] Patent: WO2009/153554, 2009, A1. Location in patent: Page/Page column 40 |
| | (3S,4S)-N-Boc-3-amino-4-hydroxypyrrolidine Preparation Products And Raw materials |
|