|
|
| | 9-hydroxy-4-androstene-3,17-dione Basic information |
| Product Name: | 9-hydroxy-4-androstene-3,17-dione | | Synonyms: | 9alpha-hydroxyandrost-4-en-3,17-dione;(8S,9R,10S,13S,14S)-9-Hydroxy-10,13-dimethyl-7,8,9,10,11,12,13,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17(2H,6H)-dione;9-hydroxy-4-androstene-3,17-dione;Androst-4-ene-3,17-dione,9-hydroxy-;(9xi)-9-hydroxyandrost-4-ene-3,17-dione;9-ALPHAHYDROXYANDROSTENEDIONE;9alpha-Hydroxyandrost-4-ene-3,17-dione;9α-hydroxyandrost-4-en-3,17-dione | | CAS: | 560-62-3 | | MF: | C19H26O3 | | MW: | 302.41 | | EINECS: | 611-349-9 | | Product Categories: | | | Mol File: | 560-62-3.mol |  |
| | 9-hydroxy-4-androstene-3,17-dione Chemical Properties |
| Melting point | 222-223.5 °C | | Boiling point | 470.3±45.0 °C(Predicted) | | density | 1.19±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 14.17±0.60(Predicted) | | InChI | InChI=1S/C19H26O3/c1-17-9-10-19(22)15(14(17)5-6-16(17)21)4-3-12-11-13(20)7-8-18(12,19)2/h11,14-15,22H,3-10H2,1-2H3/t14-,15-,17-,18-,19+/m0/s1 | | InChIKey | SNMVJSSWZSJOGL-PLOWYNNNSA-N | | SMILES | C1(=O)C=C2[C@](C)(CC1)[C@]1(O)[C@]([H])([C@@]3([H])[C@@](CC1)(C)C(=O)CC3)CC2 |
| | 9-hydroxy-4-androstene-3,17-dione Usage And Synthesis |
| Uses | 9α-Hydroxyandrost-4-ene-3,17-dione is an used in the manufacture of highly effective fluorinated anti-inflammatory remedies. | | Definition | ChEBI: A 3-oxo-Delta4-steroid that is androst-4-ene substituted by oxo groups at positions 3 and 17 and a hydroxy group at position 9. |
| | 9-hydroxy-4-androstene-3,17-dione Preparation Products And Raw materials |
|