| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
4-Chloro-2,6-dinitroaniline manufacturers
|
| | 4-Chloro-2,6-dinitroaniline Basic information |
| Product Name: | 4-Chloro-2,6-dinitroaniline | | Synonyms: | 2,6-dinitro-4-chloro-anilin;4-chloro-2,6-dinitro-anilin;4-chloro-2,6-dinitro-benzenamin;4-chloro-2,6-dinitro-Benzenamine;Benzenamine, 4-chloro-2,6-dinitro-;2,6-DINITRO-4-CHLOROANILINE;TIMTEC-BB SBB003374;benzenamine,-chloro-2,6-dinitro- | | CAS: | 5388-62-5 | | MF: | C6H4ClN3O4 | | MW: | 217.57 | | EINECS: | 226-381-5 | | Product Categories: | Amines;C2 to C6;Nitrogen Compounds | | Mol File: | 5388-62-5.mol |  |
| | 4-Chloro-2,6-dinitroaniline Chemical Properties |
| Melting point | 145-147 °C (lit.) | | Boiling point | 280°C (rough estimate) | | density | 2.0410 (rough estimate) | | refractive index | 1.6000 (estimate) | | pka | -6.03±0.25(Predicted) | | Henry's Law Constant | 7.6×101 mol/(m3Pa) at 25℃, HSDB (2015) | | InChI | 1S/C6H4ClN3O4/c7-3-1-4(9(11)12)6(8)5(2-3)10(13)14/h1-2H,8H2 | | InChIKey | CLMQUEQFVUMDPC-UHFFFAOYSA-N | | SMILES | Nc1c(cc(Cl)cc1[N+]([O-])=O)[N+]([O-])=O | | EPA Substance Registry System | 4-Chloro-2,6-dinitroaniline (5388-62-5) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-28-36/37/39-45 | | WGK Germany | 3 | | RTECS | BX9250000 | | TSCA | TSCA listed | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Acute Tox. 1 Dermal
Acute Tox. 2 Inhalation
Acute Tox. 2 Oral
Aquatic Chronic 2
STOT RE 2 | | Hazardous Substances Data | 5388-62-5(Hazardous Substances Data) |
| | 4-Chloro-2,6-dinitroaniline Usage And Synthesis |
| Uses | Standard molar enthalpy of formation of 4-chloro-2,6-dinitroaniline has been evaluated. | | General Description | Standard molar enthalpy of formation of 4-chloro-2,6-dinitroaniline has been evaluated. |
| | 4-Chloro-2,6-dinitroaniline Preparation Products And Raw materials |
|