| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
TCI Europe |
| Tel: |
320-37350700 |
| Email: |
sales@tcieurope.eu |
| Company Name: |
TCI AMERICA |
| Tel: |
800-4238616 |
| Email: |
sales@tciamerica.com |
|
| | 4-Benzyloxy-3-methoxyphenylacetic acid Basic information |
| | 4-Benzyloxy-3-methoxyphenylacetic acid Chemical Properties |
| Melting point | 100-102 °C (lit.) | | Boiling point | 440.1±35.0 °C(Predicted) | | density | 1+-.0.06 g/cm3(Predicted) | | form | powder to crystal | | pka | 4.33±0.10(Predicted) | | color | White to Light yellow | | InChI | 1S/C16H16O4/c1-19-15-9-13(10-16(17)18)7-8-14(15)20-11-12-5-3-2-4-6-12/h2-9H,10-11H2,1H3,(H,17,18) | | InChIKey | AYCIHUSEBJLTBF-UHFFFAOYSA-N | | SMILES | COc1cc(CC(O)=O)ccc1OCc2ccccc2 |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-41-37/38-22 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2918999090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
| | 4-Benzyloxy-3-methoxyphenylacetic acid Usage And Synthesis |
| Uses | 4-Benzyloxy-3-methoxyphenylacetic acid may be used as one of the reactant in the synthesis of 1,2-bis(4-benzyloxy-3-methoxyphenyl)-3-hydroxy-propionic acid. | | General Description | 4-Benzyloxy-3-methoxyphenylacetic acid is an aromatic phenyl acetic acid. It has been synthesized by the benzylation of 4-hydroxy-3-methoxyphenylacetic acid. |
| | 4-Benzyloxy-3-methoxyphenylacetic acid Preparation Products And Raw materials |
|