3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanoate manufacturers
|
| | 3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanoate Basic information |
| | 3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanoate Chemical Properties |
| Melting point | 119-120 °C(Solv: chloroform (67-66-3)) | | Boiling point | 433.4±47.0 °C(Predicted) | | density | 1.299±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | solid | | pka | 4.07±0.10(Predicted) | | InChI | 1S/C11H10N2O3/c14-10(15)7-6-9-12-11(13-16-9)8-4-2-1-3-5-8/h1-5H,6-7H2,(H,14,15) | | InChIKey | UBSBRLFVQKHLPG-UHFFFAOYSA-N | | SMILES | O=C(O)CCC1=NC(C2=CC=CC=C2)=NO1 |
| Hazard Codes | Xn | | Risk Statements | 22 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanoate Usage And Synthesis |
| Uses | 3-(3-Phenyl-1,2,4-oxadiazol-5-yl)propanoic Acid is a useful reactant for N-arylamide oxadiazole preparation as selective oral CB2 agonists. |
| | 3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanoate Preparation Products And Raw materials |
|