| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
9,9-Bis(4-amino-3-methylphenyl)fluorene manufacturers
|
| | 9,9-Bis(4-amino-3-methylphenyl)fluorene Basic information |
| Product Name: | 9,9-Bis(4-amino-3-methylphenyl)fluorene | | Synonyms: | 4,4'-(9-FLUORENYLIDENE)DI-O-TOLUIDINE;9,9-BIS(3-METHYL-4-AMINOPHENYL)FLUORENE;2,2'-DIMETHYL-4,4'-(9-FLUORENYLIDENE)DIANILINE;9,9-BIS(4-AMINO-3-METHYLPHENYL)FLUORENE 98+% T;9,9-Bis(4-aMino-3-Methylphenyl)flurorene;2,2'-Dimethyl-4,4'-(9-fluorenylidene)dianiline
4,4'-(9-Fluorenylidene)di-o-toluidine;9,9-Bis(4-amino-3-methylphenyl)fluorene >;Benzenamine, 4,4'-(9H-fluoren-9-ylidene)bis[2-methyl- | | CAS: | 107934-60-1 | | MF: | C27H24N2 | | MW: | 376.49 | | EINECS: | | | Product Categories: | Fluorenes;Fluorenes & Fluorenones | | Mol File: | 107934-60-1.mol |  |
| | 9,9-Bis(4-amino-3-methylphenyl)fluorene Chemical Properties |
| Melting point | 233 °C | | Boiling point | 545.5±50.0 °C(Predicted) | | density | 1.205 | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | Water Solubility | Insoluble in water | | form | powder to crystal | | pka | 4.76±0.10(Predicted) | | color | White to Orange to Green | | InChI | InChI=1S/C27H24N2/c1-17-15-19(11-13-25(17)28)27(20-12-14-26(29)18(2)16-20)23-9-5-3-7-21(23)22-8-4-6-10-24(22)27/h3-16H,28-29H2,1-2H3 | | InChIKey | YRKVLGUIGNRYJX-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(N)C(C)=C2)(C2=CC=C(N)C(C)=C2)C2=C(C=CC=C2)C2=C1C=CC=C2 |
| | 9,9-Bis(4-amino-3-methylphenyl)fluorene Usage And Synthesis |
| Chemical Properties | 9,9-Bis(4-amino-3-methylphenyl)fluorene has a relatively high melting point, likely around 250°C. It is generally readily soluble in organic solvents such as ethanol, acetone, and DMAc, but poorly soluble in water. | | Uses | As a multifunctional compound, 9,9-Bis(4-amino-3-methylphenyl)fluorene can be used as an intermediate in organic synthesis for the synthesis of other complex molecules. Due to its conjugated π-electron system, it can be used to prepare organic electronic materials, such as semiconductor materials in organic optoelectronic devices. |
| | 9,9-Bis(4-amino-3-methylphenyl)fluorene Preparation Products And Raw materials |
|