| Company Name: |
LGM Pharma |
| Tel: |
1-(800)-881-8210 |
| Email: |
inquiries@lgmpharma.com |
Phenyltoloxamine citrate manufacturers
|
| | Phenyltoloxamine citrate Basic information |
| Product Name: | Phenyltoloxamine citrate | | Synonyms: | ethanamine,n,n-dimethyl-2-[2-(phenylmethyl)phenoxy]-,2-hydroxy-1,2,3-propanet;n,n-dimethyl-2-((alpha-phenyl-o-tolyl)oxy)-ethylamincitrate(1:1);nih10121;phenoxadrincitrate;2-BENZHYDRYL B-DIMETHYLAMINOETHYL ETHER DIHYDROGEN CITRATE;2-(2-DIMETHYLAMINOETHOXY)DIPHENYL METHANE DIHYDROGEN CITRATE;2-(2-BENZYLPHENOXY)ETHYL-DIMETHYL-AMMONIUM 3-CARBOXY-3,5-DIHYDROXY-5-OXO-PENTANOATE;phenoxadrine citrate | | CAS: | 1176-08-5 | | MF: | C23H29NO8 | | MW: | 447.48 | | EINECS: | 214-644-7 | | Product Categories: | | | Mol File: | 1176-08-5.mol |  |
| | Phenyltoloxamine citrate Chemical Properties |
| Melting point | >255°C (dec.) | | storage temp. | -20°C Freezer | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | White | | InChI | 1S/C17H21NO.C6H8O7/c1-18(2)12-13-19-17-11-7-6-10-16(17)14-15-8-4-3-5-9-15;7-3(8)1-6(13,5(11)12)2-4(9)10/h3-11H,12-14H2,1-2H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) | | InChIKey | ZZYHCCDMBJTROG-UHFFFAOYSA-N | | SMILES | OC(=O)CC(O)(CC(O)=O)C(O)=O.CN(C)CCOc1ccccc1Cc2ccccc2 | | CAS DataBase Reference | 1176-08-5(CAS DataBase Reference) | | EPA Substance Registry System | Ethanamine, N,N-dimethyl-2-[2-(phenylmethyl)phenoxy]-, 2-hydroxy-1,2,3-propanetricarboxylate (1:1) (1176-08-5) |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 36 | | WGK Germany | 3 | | RTECS | KR6650000 | | TSCA | TSCA listed | | HS Code | 2922190900 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | Phenyltoloxamine citrate Usage And Synthesis |
| Uses | Phenyltoloxamine Citrate Salt is a reagent in the enhancement of antitussive agents (antihistamines), in cold remedy formulations. |
| | Phenyltoloxamine citrate Preparation Products And Raw materials |
|