|
|
| | 2-Amino-5-pyrimidinecarboxyaldehyde Basic information |
| | 2-Amino-5-pyrimidinecarboxyaldehyde Chemical Properties |
| Melting point | 209-214°C | | Boiling point | 372.7±34.0 °C(Predicted) | | density | 1.370±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | solid | | pka | 1.99±0.10(Predicted) | | Appearance | Off-white to yellow Solid | | InChI | InChI=1S/C5H5N3O/c6-5-7-1-4(3-9)2-8-5/h1-3H,(H2,6,7,8) | | InChIKey | DPOYRRAYGKTRAU-UHFFFAOYSA-N | | SMILES | C1(N)=NC=C(C=O)C=N1 | | CAS DataBase Reference | 120747-84-4(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 22-43-36/37/38 | | Safety Statements | 36/37-37/39-26 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Skin Sens. 1 |
| | 2-Amino-5-pyrimidinecarboxyaldehyde Usage And Synthesis |
| Chemical Properties | Light brown solid | | Synthesis Reference(s) | Journal of Heterocyclic Chemistry, 28, p. 1281, 1991 DOI: 10.1002/jhet.5570280520 | | Synthesis | General procedure for the synthesis of 2-amino-5-pyrimidinecarboxaldehyde from methyl 2-aminopyrimidine-5-carboxylate: methyl 2-aminopyrimidine-5-carboxylate (300 mg, 2.0 mmol) was dissolved in methanol (5 mL) containing a few drops of water. Subsequently, lithium hydroxide (122 mg, 5.1 mmol) was added and the reaction mixture was stirred and reacted at 60 °C overnight. Upon completion of the reaction, the mixture was concentrated under reduced pressure, after which it was diluted with water and the pH was adjusted with 1 M HCl solution to 4. At this point, 2-aminopyrimidine-5-carboxylic acid precipitated as a white solid, which was isolated by vacuum filtration to give the product (244 mg, 90% yield). The structure of the product was confirmed by 1H NMR (DMSO-d6), δ: 12.73 (1H, broad peak), 8.63 (2H, single peak), 7.44 (2H, broad peak). | | References | [1] Patent: WO2012/62748, 2012, A1. Location in patent: Page/Page column 53-54 |
| | 2-Amino-5-pyrimidinecarboxyaldehyde Preparation Products And Raw materials |
|