- 5(6)-FAM SE
-
- $79.00 / 50mg
-
2026-01-30
- CAS:117548-22-8
- Min. Order:
- Purity: 99.77%
- Supply Ability: 10g
|
| | 5(6)-Carboxyfluorescein N-succinimidyl ester Basic information |
| Product Name: | 5(6)-Carboxyfluorescein N-succinimidyl ester | | Synonyms: | FLUOS;5-(AND-6)-CARBOXYFLUORESCEIN, SUCCINIMIDYL ESTER;5-(AND-6)-CARBOXY SNAFL(R)-1, SUCCINIMIDYL ESTER;5-(AND-6)-CARBOXY SNAFL(R)-2, SUCCINIMIDYL ESTER;5(6)-CARBOXYFLUORESCEIN, NHS ESTER;5(6)-CARBOXYFLUORESCEIN N-HYDROXYSUCCINIMIDE ESTER;5(6)-CARBOXYFLUORESCEIN N-SUCCINIMIDYL ESTER;5,6-CARBOXYFLUORESCEIN SE | | CAS: | 117548-22-8 | | MF: | C24H15NO7 | | MW: | 429.383 | | EINECS: | | | Product Categories: | marker;FLUOROPHORES;FAM | | Mol File: | 117548-22-8.mol |  |
| | 5(6)-Carboxyfluorescein N-succinimidyl ester Chemical Properties |
| Melting point | 224°C | | storage temp. | -20°C | | solubility | DMF: soluble | | form | Solid | | color | Light Orange | | InChI | InChI=1S/C24H15NO7/c26-13-5-7-17-19(11-13)31-20-12-14(27)6-8-18(20)23(17)15-3-1-2-4-16(15)24(30)32-25-21(28)9-10-22(25)29/h1-8,11-12,26H,9-10H2 | | InChIKey | VQTBINYMFPKLQD-UHFFFAOYSA-N | | SMILES | C1(=C2C=CC(=O)C=C2OC2C=C(O)C=CC1=2)C1C=CC=CC=1C(=O)ON1C(=O)CCC1=O |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 32049010 | | Storage Class | 11 - Combustible Solids |
| | 5(6)-Carboxyfluorescein N-succinimidyl ester Usage And Synthesis |
| Chemical Properties | Light red solid | | Uses | 5(6)-Carboxyfluorescein N-hydroxysuccinimide ester (5(6)-FAM SE, FLUOS) may be used to prepare fluorescent derivatives of proteins such as tubulin and for the preparation of a phenytoin tracer for the determination of this and other drugs in serum and plasma by fluorescence polarization immunoassay (FPIA) and laser-induced fluorescence detection. | | Uses | 5(6)-Carboxyfluorescein N-succinimidyl ester is an amine-reactive green fluorescent dye widely used for labeling proteins or other biomolecules that contain a primary or secondary aliphatic amine. |
| | 5(6)-Carboxyfluorescein N-succinimidyl ester Preparation Products And Raw materials |
|