| Company Name: |
Chemwill Asia Co.,Ltd.
|
| Tel: |
86-21-51086038 |
| Email: |
chemwill_asia@126.com |
| Products Intro: |
CAS:4609-10-3
Purity:99% Package:5KG;1KG;25KG
|
|
| | 5-(4-methoxyphenyl)-5-oxopentanoic acid Basic information |
| Product Name: | 5-(4-methoxyphenyl)-5-oxopentanoic acid | | Synonyms: | 5-(4-methoxyphenyl)-5-oxopentanoic acid;OTAVA-BB 1043540;UKRORGSYN-BB BBV-213302;5-keto-5-(4-methoxyphenyl)valeric acid;4-p-Anisoylbutyric acid;NSC 105618;4-(4-Methoxybenzoyl)butyric acid;Benzenepentanoic acid, 4-methoxy-δ-oxo- | | CAS: | 4609-10-3 | | MF: | C12H14O4 | | MW: | 222.24 | | EINECS: | | | Product Categories: | | | Mol File: | 4609-10-3.mol |  |
| | 5-(4-methoxyphenyl)-5-oxopentanoic acid Chemical Properties |
| Melting point | 137 °C | | Boiling point | 426.7±25.0 °C(Predicted) | | density | 1.175±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 4.61±0.10(Predicted) | | Appearance | Off-white to yellow Solid | | InChI | InChI=1S/C12H14O4/c1-16-10-7-5-9(6-8-10)11(13)3-2-4-12(14)15/h5-8H,2-4H2,1H3,(H,14,15) | | InChIKey | UAMMMFTXGWKQLG-UHFFFAOYSA-N | | SMILES | C(O)(=O)CCCC(=O)C1=CC=C(OC)C=C1 |
| | 5-(4-methoxyphenyl)-5-oxopentanoic acid Usage And Synthesis |
| | 5-(4-methoxyphenyl)-5-oxopentanoic acid Preparation Products And Raw materials |
|