1,3-DIOLEIN manufacturers
|
| | 1,3-DIOLEIN Basic information |
| Product Name: | 1,3-DIOLEIN | | Synonyms: | ASTM D6584 1,3-Diolein solution;1,3-Dioleoyl-rac-glycerol;GLYCEROL-1,2- AND -1,3-DIOLEATE;DIOLEIN;DIOLEOYL GLYCEROL;DELTA 9 CIS DIOLEIN;DELTA 9 CIS DIOLEIN 1-3 ISOMER;1,3-DI-[(CIS)-9-OCTADECENOYL]GLYCEROL | | CAS: | 2465-32-9 | | MF: | C39H72O5 | | MW: | 620.99 | | EINECS: | 219-569-3 | | Product Categories: | | | Mol File: | 2465-32-9.mol |  |
| | 1,3-DIOLEIN Chemical Properties |
| Melting point | 21.5°C | | Boiling point | 581.86°C (rough estimate) | | density | 0.9170 | | refractive index | 1.4800 (estimate) | | Fp | 17℃ | | storage temp. | 2-8°C | | solubility | Chloroform: soluble | | form | A liquid | | pka | 12.63±0.20(Predicted) | | biological source | plant | | InChIKey | DRAWQKGUORNASA-CLFAGFIQSA-N | | SMILES | CCCCCCCC\C=C/CCCCCCCC(=O)OCC(O)COC(=O)CCCCCCC\C=C\CCCCCCCC | | LogP | 15.430 (est) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | UN1282 - class 3 - PG 2 - Pyridine, solution | | WGK Germany | 1 | | Storage Class | 11 - Combustible Solids |
| | 1,3-DIOLEIN Usage And Synthesis |
| Uses | 1,3-Dioleoylglycerol is used in the synthesis of amphiphilic gadolinium complexes as MRI contrast agents. | | Definition | ChEBI: A 1,3-diglyceride with both acyl groups specified as oleoyl. |
| | 1,3-DIOLEIN Preparation Products And Raw materials |
|