1,2-DIOLEOYL-RAC-GLYCEROL manufacturers
- (±)-1,2-Diolein
-
- $2.00
-
2026-08-20
- CAS:2442-61-7
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100kg
- (±)-1,2-Diolein
-
- $247.00
-
2026-05-11
- CAS:2442-61-7
- Purity:
- Supply Ability: 10g
|
| | 1,2-DIOLEOYL-RAC-GLYCEROL Basic information |
| Product Name: | 1,2-DIOLEOYL-RAC-GLYCEROL | | Synonyms: | RAC-1,2-DIOLEOYLGLYCEROL;RAC-GLYCEROL 1,2-DIOLEATE;(+/-)-DIOLEOYLGLYCEROL;(+/-)-1,2-DIOLEIN;(+/-)1,2-DIOLEOYLGLYCEROL;1,2-DIOLEOYL-RAC-GLYCEROL;1,2-DI[CIS-9-OCTADECENOYL]-RAC-GLYCEROL;diolein solution | | CAS: | 2442-61-7 | | MF: | C39H72O5 | | MW: | 620.99 | | EINECS: | | | Product Categories: | Miscellaneous | | Mol File: | 2442-61-7.mol |  |
| | 1,2-DIOLEOYL-RAC-GLYCEROL Chemical Properties |
| Boiling point | 670.8±35.0 °C(Predicted) | | density | 0.9218 g/cm3 | | Fp | 17 °C | | storage temp. | −20°C | | solubility | DMF: 10 mg/ml; Ethanol: 10 mg/ml; Ethanol:PBS(pH 7.2) (1:1): .5 mg/ml | | pka | 13.69±0.10(Predicted) | | form | Colorless oil or waxy solid. | | biological source | synthetic (organic) | | BRN | 1917687 | | Stability: | Light sensitive, Volatile | | InChIKey | AFSHUZFNMVJNKX-CLFAGFIQSA-N | | SMILES | C(OC(=O)CCCCCCC/C=C\CCCCCCCC)(CO)COC(=O)CCCCCCC/C=C\CCCCCCCC |
| Hazard Codes | F,Xn | | Risk Statements | 11-20/21/22 | | Safety Statements | 36/37 | | RIDADR | UN 1282 3/PG 2 | | WGK Germany | 3 | | F | 10 | | Storage Class | 11 - Combustible Solids |
| | 1,2-DIOLEOYL-RAC-GLYCEROL Usage And Synthesis |
| Uses | 1,2-Dioleoyl-rac-glycerol is an analog of 1,3-Dioleoylglycerol (D484210) which is used in the synthesis of amphiphilic gadolinium complexes as MRI contrast agents. | | Definition | ChEBI: 1,2-dioleoylglycerol is a 1,2-diglyceride and a dioleoylglycerol. |
| | 1,2-DIOLEOYL-RAC-GLYCEROL Preparation Products And Raw materials |
|