| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-Methoxycyclohexanecarboxylic acid Basic information |
| Product Name: | 4-Methoxycyclohexanecarboxylic acid | | Synonyms: | LABOTEST-BB LT00452096;4-methoxycyclohexylcarboxylic acid;4-Methoxycyclohexanecarboxylic acid, Mixture of cis and trans 97%;4-METHOXYCYCLOHEXANECARBOXYLIC ACID, 97% , MIXTURE OF CIS AND TRANS;4-methoxycyclohexanecarboxylic acid, mixture of cis and trans;4-Methoxycyclohexane-1-carboxylic acid;Cyclohexanecarboxylic acid, 4-methoxy-;4-Methoxycyclohexanecarboxylic acid, mixture of cis and trans | | CAS: | 95233-12-8 | | MF: | C8H14O3 | | MW: | 158.2 | | EINECS: | | | Product Categories: | C8;Carbonyl Compounds;Carboxylic Acids | | Mol File: | 95233-12-8.mol |  |
| | 4-Methoxycyclohexanecarboxylic acid Chemical Properties |
| Melting point | 55.5-58.5 °C | | Boiling point | 150-165 °C(Press: 25 Torr) | | density | 1.09±0.1 g/cm3(Predicted) | | refractive index | n20/D 1.4687(lit.) | | Fp | >230 °F | | storage temp. | Storage temp. 2-8°C | | pka | 4.68±0.10(Predicted) | | form | liquid | | Appearance | White to off-white <55.5°C Solid,>58.5°C Liquid | | InChI | InChI=1S/C8H14O3/c1-11-7-4-2-6(3-5-7)8(9)10/h6-7H,2-5H2,1H3,(H,9,10) | | InChIKey | WKILSRYNRQGRMA-UHFFFAOYSA-N | | SMILES | C1(C(O)=O)CCC(OC)CC1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4-Methoxycyclohexanecarboxylic acid Usage And Synthesis |
| Uses | 4-Methoxycyclohexanecarboxylic acid is a reagent used in the discovery of a series of highly brain penetrant which are selective muscarinic M1 agonists. | | General Description | cis-4-Methoxycyclohexanecarboxylic acid reacts with methyllithium to afford ketone, cis-4-methoxy-1-acetylcyclohexane. Reaction of cis-4-methoxycyclohexanecarboxylic acid with acetic acid and catalytic amount of sulphuric acid has been investigated. |
| | 4-Methoxycyclohexanecarboxylic acid Preparation Products And Raw materials |
|