| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1-BOC-4-(PIPERIDIN-4-YL)-PIPERAZINE Basic information | | Uses |
| Product Name: | 1-BOC-4-(PIPERIDIN-4-YL)-PIPERAZINE | | Synonyms: | 4-PIPERIDIN-4-YL-PIPERAZINE-1-CARBOXYLIC ACID TERT-BUTYL ESTER;1-BOC-4-(PIPERIDIN-4-YL)-PIPERAZINE;1-BOC-4-(PIPERIDIN-4-YL)-PIPERAZINE >98%;1-Piperazinecarboxylicacid, 4-(4-piperidinyl)-, 1,1-diMethylethyl ester;1-Boc-4-(4-piperidinyl)-piperazine;2-Methylpropan-2-yl 4-(piperidin-4-yl)piperazine-1-carboxylate;1,1-Dimethylethyl 4-(4-piperidinyl)-1-piperazinecarboxylate;ert-butyl4-piperidin-4-ylpiperazine-1-carboxylate | | CAS: | 205059-24-1 | | MF: | C14H27N3O2 | | MW: | 269.38 | | EINECS: | | | Product Categories: | pharmacetical;Piperidine | | Mol File: | 205059-24-1.mol |  |
| | 1-BOC-4-(PIPERIDIN-4-YL)-PIPERAZINE Chemical Properties |
| Melting point | 70-74°C | | Boiling point | 362.9±42.0 °C(Predicted) | | density | 1.069 | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | powder | | pka | 10.27±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C14H27N3O2/c1-14(2,3)19-13(18)17-10-8-16(9-11-17)12-4-6-15-7-5-12/h12,15H,4-11H2,1-3H3 | | InChIKey | IMFPSYLOYADSFR-UHFFFAOYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCN(C2CCNCC2)CC1 |
| WGK Germany | WGK 3 | | HS Code | 2933599590 | | Storage Class | 11 - Combustible Solids |
| | 1-BOC-4-(PIPERIDIN-4-YL)-PIPERAZINE Usage And Synthesis |
| Uses | 1-Boc-4-(piperidin-4-yl)-piperazine is a heterocyclic organic compound that can be used as a pharmaceutical intermediate. | | Uses | A semi-flexible linker useful for PROTAC development for targeted protein degradation. Incorporation of rigidity into the linker region of PROTACs may impact degradation kinetics as well as ADMET properties of PROTACs.
Technology Spotlight: Degrader Building Blocks for Targeted Protein Degradation
Protein Degrader Building Blocks |
| | 1-BOC-4-(PIPERIDIN-4-YL)-PIPERAZINE Preparation Products And Raw materials |
|