| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Dimethyl 5-methoxyisophthalate Basic information |
| Product Name: | Dimethyl 5-methoxyisophthalate | | Synonyms: | 5-METHOXY-METHYL ISOPHATHALATE;5-METHOXY-ISOPHTHALIC ACID DIMETHYL ESTER;5-METHOXY-METHYL ISOPHTHALATE;5-METHOXY-DIMETHYL ISOPHATHALATE;1,3-Benzenedicarboxylic acid, 5-methoxy-, 1,3-dimethyl ester;dimethyl 5-methoxybenzene-1,3-dicarboxylate;5-methoxymetabenzenedimacetic acidimethyl ester;Dimethyl 5-methoxyisophthalate | | CAS: | 20319-44-2 | | MF: | C11H12O5 | | MW: | 224.21 | | EINECS: | | | Product Categories: | C10 to C11;Carbonyl Compounds;Esters | | Mol File: | 20319-44-2.mol |  |
| | Dimethyl 5-methoxyisophthalate Chemical Properties |
| Melting point | 108-112 °C (lit.) | | Boiling point | 323.4±22.0 °C(Predicted) | | density | 1.184±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | InChI | 1S/C11H12O5/c1-14-9-5-7(10(12)15-2)4-8(6-9)11(13)16-3/h4-6H,1-3H3 | | InChIKey | XZWYGKPSIBDYDY-UHFFFAOYSA-N | | SMILES | COC(=O)c1cc(OC)cc(c1)C(=O)OC |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | Dimethyl 5-methoxyisophthalate Usage And Synthesis |
| Uses | Dimethyl 5-methoxyisophthalate may be used as a reactant in the synthesis of 5-methoxy isophthalic acid. | | General Description | Dimethyl 5-methoxyisophthalate can be prepared by reacting 5-methoxy isophthalic acid, 5-hydroxy isophthalic acid, K2CO3 and dimethyl sulphate. |
| | Dimethyl 5-methoxyisophthalate Preparation Products And Raw materials |
|