- AC-THR(TBU)-OH
-
- $1.00
-
2019-07-06
- CAS:163277-80-3
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20kg
|
| | Ac-Thr(tBu)-OH Basic information |
| Product Name: | Ac-Thr(tBu)-OH | | Synonyms: | N-ALPHA-ACETYL-O-T-BUTYL-L-THREONINE;AC-THREONINE(TBU)-OH;ACETYL-O-T-BUTYL-L-THREONINE;Acetyl-O-tert-butyl-L-threonine≥ 99% (HPLC);(2S,3R)-2-AcetaMido-3-(tert-butoxy)butanoic acid;N-Acetyl-O-(1,1-dimethylethyl)-L-threonine;(2S,3R)-3-(tert-butoxy)-2-acetamidobutanoic acid;L-Threonine, N-acetyl-O-(1,1-dimethylethyl)- | | CAS: | 163277-80-3 | | MF: | C10H19NO4 | | MW: | 217.26 | | EINECS: | | | Product Categories: | | | Mol File: | 163277-80-3.mol |  |
| | Ac-Thr(tBu)-OH Chemical Properties |
| Melting point | 137°C | | Boiling point | 395.4±37.0 °C(Predicted) | | density | 1.079±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | powder | | pka | 3.31±0.10(Predicted) | | Appearance | White to off-white Solid | | Major Application | peptide synthesis | | InChI | 1S/C10H19NO4/c1-6(15-10(3,4)5)8(9(13)14)11-7(2)12/h6,8H,1-5H3,(H,11,12)(H,13,14)/t6,8-/m0/s1 | | InChIKey | JTQQJUFULLOMEJ-XDKWHASVSA-N | | SMILES | O=C(O)[C@H]([C@@H](OC(C)(C)C)C)NC(C)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Ac-Thr(tBu)-OH Usage And Synthesis |
| Uses | peptide synthesis | | General Description | Ac-Thr(t-Bu)-OH is a threonine derivative. |
| | Ac-Thr(tBu)-OH Preparation Products And Raw materials |
|