15(S)-Latanoprost manufacturers
|
| | 15(S)-Latanoprost Basic information |
| Product Name: | 15(S)-Latanoprost | | Synonyms: | 15(S)-LATANOPROST;15(S)-LATANOPROST ISOPROPYL ESTER;15-EPI LATANOPROST ISOPROPYL ESTER;9ALPHA,11ALPHA,15S-TRIHYDROXY-17-PHENYL-18,19,20-TRINOR-PROST-5Z-EN-1-OIC ACID ISOPROPYL ESTER;(5Z,9ALPHA,11ALPHA,15S)-9,11,15-TRIHYDROXY-17-PHENYL-18,19,20-TRINOR-PROST-5Z-EN-1-OATE ISOPROPYL ESTER;(Z)-7-[(1R,2R,3R,5S)-3,5-Dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoic acid isopropyl ester;15-epi Latanoprost;Latanoprost Related Compound B (25 mg) (Isopropyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3S)-3-hydroxy-5-phenylpentyl]cyclopentyl]-5-heptenoate) | | CAS: | 145773-22-4 | | MF: | C26H40O5 | | MW: | 432.59 | | EINECS: | 687-773-3 | | Product Categories: | Chiral Reagents;Inhibitors;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 145773-22-4.mol |  |
| | 15(S)-Latanoprost Chemical Properties |
| Boiling point | 583.8±50.0 °C(Predicted) | | density | 1.093±0.06 g/cm3(Predicted) | | Fp | -16 °C | | storage temp. | −20°C | | solubility | DMF: 100 mg/ml; DMSO: 100 mg/ml; DMSO:PBS (1:12): 80 μg/ml; Ethanol: 100 mg/ml | | pka | 14.84±0.70(Predicted) | | form | Oil | | color | Colourless | | Major Application | pharmaceutical | | InChIKey | GGXICVAJURFBLW-SCTZCWPJSA-N | | SMILES | O[C@H]1[C@@H]([C@H]([C@H](C1)O)C\C=C/CCCC(=O)OC(C)C)CC[C@H](O)CCc2ccccc2 |
| Hazard Codes | F,Xi | | Risk Statements | 11-36-66-67 | | Safety Statements | 16-26-29-33 | | RIDADR | UN 1231 3/PG 2 | | WGK Germany | 1 | | HS Code | 2937500000 | | Storage Class | 10 - Combustible liquids |
| | 15(S)-Latanoprost Usage And Synthesis |
| Uses | An impurity of commercially prepared Latanoprost (L177280). Latanoprost USP Related Compound B. |
| | 15(S)-Latanoprost Preparation Products And Raw materials |
|