|
|
| | 2,4,5-Trifluoro-3-methoxybenzoic acid Basic information |
| Product Name: | 2,4,5-Trifluoro-3-methoxybenzoic acid | | Synonyms: | 3-Methoxyl-2,4,5-TrfluorbenzylAcid;3-METHOXY-2,4,5-TRIFLUOROBENZOYL CHLORIDE;3-Methoxy-2,4,5-trifluoroenzoic acid;2,4,5-Tetrafluoro-3-methoxybenzoic acid;3-Menthoxy-2,4,5-TrifluorobenzoicAcid/2,4,5-Trifluoro-3-MethoxybenzoicAcid;2,4,5-Trifluoro-3-Methoxy;3-Methoxy-2,4,5-trifluorobenzoic acid 98%;3-Methoxy-2,4,5-trifluorobenzoicacid98% | | CAS: | 112811-65-1 | | MF: | C8H5F3O3 | | MW: | 206.12 | | EINECS: | 000-000-0 | | Product Categories: | Chemical Synthesis;Fluorinated Building Blocks;Organic Building Blocks;Organic Fluorinated Building Blocks;Other Fluorinated Organic Building Blocks;Aryl Fluorinated Building Blocks;Building Blocks;C7-C8;Carbonyl Compounds;Carboxylic Acids;Benzoic acid;API intermediates;C8;Carbonyl Compounds;Carboxylic Acids;bc0001;OLED | | Mol File: | 112811-65-1.mol |  |
| | 2,4,5-Trifluoro-3-methoxybenzoic acid Chemical Properties |
| Melting point | 105-112 °C(lit.) | | Boiling point | 284.3±35.0 °C(Predicted) | | density | 1.472 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.503(lit.) | | Fp | 126 °F | | storage temp. | Sealed in dry,Room Temperature | | pka | 2.75±0.10(Predicted) | | form | powder to crystal | | color | White to Almost white | | BRN | 7428474 | | InChI | InChI=1S/C8H5F3O3/c1-14-7-5(10)3(8(12)13)2-4(9)6(7)11/h2H,1H3,(H,12,13) | | InChIKey | YVJHZWWMKFQKDC-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC(F)=C(F)C(OC)=C1F | | CAS DataBase Reference | 112811-65-1(CAS DataBase Reference) |
| | 2,4,5-Trifluoro-3-methoxybenzoic acid Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | 2,4,5-Trifluoro-3-methoxybenzoic acid may be used as a precursor for the preparation of quinolone derivatives. It may also be used to synthesize 1-(carboxymethyl)-6,7-difluoro-8-methoxy-4-oxo-1,4-dihydroquinoline-3-carboxylic acid and triaqua (1,10-phenanthroline-κ2N, N′)(2, 4, 5-trifluoro-3-methoxybenzoato-κO1) cobalt (II) 2, 4, 5-trifluoro-3-methoxybenzoate. | | General Description | 2,4,5-Trifluoro-3-methoxybenzoic acid readily forms organotin(IV) complexes. |
| | 2,4,5-Trifluoro-3-methoxybenzoic acid Preparation Products And Raw materials |
|