|
|
| | 3-PHENYL-CYCLOBUTAN-1-ONE Basic information |
| | 3-PHENYL-CYCLOBUTAN-1-ONE Chemical Properties |
| Boiling point | 109-118 °C(Press: 10 Torr) | | density | 1+-.0.06 g/cm3(Predicted) | | refractive index | 1.544 | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | color | Light yellow | | InChI | InChI=1S/C10H10O/c11-10-6-9(7-10)8-4-2-1-3-5-8/h1-5,9H,6-7H2 | | InChIKey | BVQSFCUGCAZOJQ-UHFFFAOYSA-N | | SMILES | C1(=O)CC(C2=CC=CC=C2)C1 |
| Hazard Codes | Xi | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 2914390090 |
| | 3-PHENYL-CYCLOBUTAN-1-ONE Usage And Synthesis |
| | 3-PHENYL-CYCLOBUTAN-1-ONE Preparation Products And Raw materials |
|