|
|
| | 3-Methylenecyclobutanecarbonitrile Basic information |
| Product Name: | 3-Methylenecyclobutanecarbonitrile | | Synonyms: | 3-METHYLENE-1-CYANOCYCLOBUTANE;3-Methylene-1-cyclobutanecarbonitrile;3-Methylenecyclobutane-1-carbonitrile;3-methylenecyclobutanecarbonitrile(SALTDATA: FREE);1-Cyano-3-methylidenecyclobutane;3-Methylenecyclobutanecarbonitrile 97% (GC);3-METHYLENECYCLOBUTANECARBONITRILE;3-METHYLENE CYCLOBUTYL CARBONITRILE | | CAS: | 15760-35-7 | | MF: | C6H7N | | MW: | 93.13 | | EINECS: | | | Product Categories: | Ring Systems | | Mol File: | 15760-35-7.mol |  |
| | 3-Methylenecyclobutanecarbonitrile Chemical Properties |
| Melting point | 149-150 ºC | | Boiling point | 163.58°C (rough estimate) | | density | 0.912 g/mL at 25 °C | | refractive index | n20/D1.461 | | Fp | 58℃ | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | form | liquid | | color | Clear, colourless | | InChI | InChI=1S/C6H7N/c1-5-2-6(3-5)4-7/h6H,1-3H2 | | InChIKey | ZRWMAMOBIQQJSA-UHFFFAOYSA-N | | SMILES | C1(C#N)CC(=C)C1 | | CAS DataBase Reference | 15760-35-7(CAS DataBase Reference) | | NIST Chemistry Reference | 3-Methylenecyclobutane-carbonitrile(15760-35-7) |
| Hazard Codes | Xi,Xn | | Risk Statements | 20/21/22-36/37/38-43 | | Safety Statements | 26-36/37/39-36/37-7/9 | | RIDADR | 3276 | | WGK Germany | 3 | | HazardClass | IRRITANT | | PackingGroup | Ⅲ | | HS Code | 2926907090 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Oral
Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Eye Irrit. 2
Flam. Liq. 3
Skin Irrit. 2
Skin Sens. 1
STOT SE 3 | | Toxicity | mouse,LD50,intraperitoneal,250mg/kg (250mg/kg),National Technical Information Service. Vol. AD603-561, |
| | 3-Methylenecyclobutanecarbonitrile Usage And Synthesis |
| Chemical Properties | Colorless liquid | | Uses | 3-Methylenecyanocyclobutane is a compound that can undergo hydrophosphination with phosphine boranes and phosphites to prepare novel cyclobutyl-P derivatives. |
| | 3-Methylenecyclobutanecarbonitrile Preparation Products And Raw materials |
|