|
|
| | Oxasulfuron Basic information |
| Product Name: | Oxasulfuron | | Synonyms: | oxasulfuron oxetan-3-yl 2-[(4,6-dimethylpyrimidin-2-yl)-carbamoylsulfamoyl]benzoate;Benzoic acid, 2-(((((4,6-dimethyl-2-pyrimidinyl)amino)carbonyl)amino)sulfonyl)-, 3-oxetanyl ester;Cga-277476 herbicide;Ep-A 0496701;Oxasulfuron [iso];oxetan-3-yl 2-(N-((4,6-diMethylpyriMidin-2-yl)carbaMoyl)sulfaMoyl)benzoate;OXASULFURON;OXETAN-3-YL 2-[(4,6-DIMETHYLPYRIMIDIN-2-YL)CARBAMOYLSULFAMOYL]BENZOATE | | CAS: | 144651-06-9 | | MF: | C17H18N4O6S | | MW: | 406.41 | | EINECS: | 604-430-5 | | Product Categories: | | | Mol File: | 144651-06-9.mol |  |
| | Oxasulfuron Chemical Properties |
| Melting point | 158°C (decomposition) | | density | 1.49±0.1 g/cm3(Predicted) | | solubility | Solubility in organic solvents (g/l at 25 °C)
Acetone 9.3
Ethyl acetate 2.3
Dichloromethane 69.0
n-Hexane 0.0022
Toluene 0.32 | | pka | Dissociation constant (pKa) 5.10 | | Water Solubility | Solubility in water (g/l at 25 °C)
0.052 (pH 5.1)
0.063 (pH 5.0, buffer solution)
1.70 (pH 6.8, buffer solution)
19.0 (pH 7.8, buffer solution) | | Major Application | agriculture environmental | | InChI | 1S/C17H18N4O6S/c1-10-7-11(2)19-16(18-10)20-17(23)21-28(24,25)14-6-4-3-5-13(14)15(22)27-12-8-26-9-12/h3-7,12H,8-9H2,1-2H3,(H2,18,19,20,21,23) | | InChIKey | IOXAXYHXMLCCJJ-UHFFFAOYSA-N | | SMILES | Cc1cc(C)nc(NC(=O)NS(=O)(=O)c2ccccc2C(=O)OC3COC3)n1 | | CAS DataBase Reference | 144651-06-9(CAS DataBase Reference) | | EPA Substance Registry System | Oxasulfuron (144651-06-9) |
| Hazard Codes | Xn;N,N,Xn | | Risk Statements | 48/22-50/53 | | Safety Statements | 46-60-61 | | RIDADR | UN 3077 | | WGK Germany | 3 | | HS Code | 29350090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 STOT RE 2 |
| | Oxasulfuron Usage And Synthesis |
| Uses | Oxasulfuron is used in liquid sulfonylurea herbicide composition. | | Agricultural Uses | Oxasulfuron (CGA 277476) was launched in 1996 by Syngenta as a pre-emergent and post-emergent herbicide. At application rates of 66–92 g a.i. ha−1, it provides greater than 80% control of A theophrasti, X. strumarium, Amaranthus spp., A. artemisiifolia, A. trifida, Bidens pilosa, Cyperus esculentus, Polygonum pensylvanicum, Sorghum bicolor, E. crus‐galli, Helianthus annuus, Sesbania exaltata, and Ipomoea spp. in soybeans. The observed selectivity is due to the compound’s rapid metabolization in the target crop. | | Mechanism of action | Absorbed by shoots and roots and translocatInhibits plant amino acid synthesis - acetohydroxyacid synthase AHAS | | Synthesis |
Oxasulfuron is commercially prepared through a multi-step synthesis involving sulfonylurea formation and esterification. It begins with the preparation of a sulfonylurea intermediate, typically derived from 4,6-dimethyl-2-aminopyrimidine and sulfonyl isocyanate or related reagents. This intermediate is then coupled with 2-carboxybenzenesulfonyl chloride to form the sulfonylurea linkage. The resulting compound undergoes esterification with oxetan-3-ol, introducing the oxetanyl ester group that enhances herbicidal activity and environmental stability.
| | Pesticide Type | Herbicide |
| | Oxasulfuron Preparation Products And Raw materials |
|