| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
|
| | 5-Bromo-2-iodopyridin-3-yl tert-butyl carbonate Basic information |
| | 5-Bromo-2-iodopyridin-3-yl tert-butyl carbonate Chemical Properties |
| Boiling point | 380.5±42.0 °C(Predicted) | | density | 1.865±0.06 g/cm3(Predicted) | | pka | -3.72±0.10(Predicted) | | form | solid | | InChI | 1S/C10H11BrINO3/c1-10(2,3)16-9(14)15-7-4-6(11)5-13-8(7)12/h4-5H,1-3H3 | | InChIKey | ZKGZEMBHNIBNLR-UHFFFAOYSA-N | | SMILES | CC(C)(C)OC(=O)Oc1cc(Br)cnc1I |
| WGK Germany | 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | 5-Bromo-2-iodopyridin-3-yl tert-butyl carbonate Usage And Synthesis |
| | 5-Bromo-2-iodopyridin-3-yl tert-butyl carbonate Preparation Products And Raw materials |
|