| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- (S)-CIS-VERBENOL
-
-
2026-06-30
- CAS:18881-04-4
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 10000KGS
- (S)-CIS-VERBENOL
-
-
2024-10-22
- CAS:18881-04-4
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10kg/100kg
|
| | (S)-CIS-VERBENOL Basic information |
| Product Name: | (S)-CIS-VERBENOL | | Synonyms: | (1S-CIS)-4,6,6-TRIMETHYLBICYCLO[3.1.1]HEPT-3-EN-2-OL;1,2,4-trimethyl-5-[2-(2,4,5-trimethylphenyl)ethyl]benzene;(1S)-CIS-VERBENOL;(S)-CIS-VERBENOL;BICYCLO[3.3.1]HEPT-3-EN-2-OL,4,6,6-TRIMETHYL-,[1S-(1a,2b,5a)]-;(1S,1α,5α)-4,6,6-Trimethylbicyclo[3.1.1]hepta-3-ene-2β-ol;(1S,5S)-4,6,6-Trimethylbicyclo[3.1.1]hept-3-en-2β-ol;(1α,5α)-4,6,6-Trimethylbicyclo[3.1.1]hepta-3-ene-2β-ol | | CAS: | 18881-04-4 | | MF: | C10H16O | | MW: | 152.23 | | EINECS: | 242-645-2 | | Product Categories: | Fine Intermediate | | Mol File: | 18881-04-4.mol |  |
| | (S)-CIS-VERBENOL Chemical Properties |
| Melting point | 62-65 °C (lit.) | | Boiling point | 214.9±9.0 °C(Predicted) | | density | 1.002±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 14.56±0.60(Predicted) | | form | Powder | | color | Bordeaux to dark brown-red | | Odor | at 100.00 %. balsamic | | Odor Type | balsamic | | Optical Rotation | [α]20/D 9° in chloroform &_& [α]20/D +10° in ethanol | | BRN | 2206582 | | InChI | InChI=1S/C10H16O/c1-6-4-9(11)8-5-7(6)10(8,2)3/h4,7-9,11H,5H2,1-3H3/t7-,8+,9-/m0/s1 | | InChIKey | WONIGEXYPVIKFS-YIZRAAEISA-N | | SMILES | [C@]12([H])C[C@]([H])(C1(C)C)C(C)=C[C@@H]2O | | LogP | 3.160 | | EPA Substance Registry System | (S)-cis-Verbenol (18881-04-4) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 8 | | TSCA | TSCA listed | | HS Code | 29061990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (S)-CIS-VERBENOL Usage And Synthesis |
| Chemical Properties | White to pale yellow crystals | | Uses | (S)-cis-Verbenol (cas# 18881-04-4) is used as a pheromone dispenser and in the method for trapping harmful forest, horticultural and agricultural insects. | | General Description | (S)-cis-verbenol is an aggregation pheromone component in the bark beetles. It shows potent anti-oxidative and anti-inflammatory activities. |
| | (S)-CIS-VERBENOL Preparation Products And Raw materials |
|