|
|
| | 4-(Tributylstannyl)-1-tritylimidazole Basic information |
| Product Name: | 4-(Tributylstannyl)-1-tritylimidazole | | Synonyms: | 4-(Tributylstannyl)-1-tritylimidazole;4-(tributylstannanyl)-1-trityl-1H-iMidazole;1H-Imidazole, 4-(tributylstannyl)-1-(triphenylmethyl)-;SKL988;4-(Tributylstannyl)-1-tritylimidazole - [T3109];Tributyl-(1-Tritylimidazol-4-;1-triphenylmethyl-4-tributylimidazole;4-(Tributylstannyl)-1-trityl-1H-imidazole | | CAS: | 208934-35-4 | | MF: | C34H44N2Sn | | MW: | 599.44 | | EINECS: | | | Product Categories: | organic tin;Stannanes | | Mol File: | 208934-35-4.mol |  |
| | 4-(Tributylstannyl)-1-tritylimidazole Chemical Properties |
| Boiling point | 611.6±47.0 °C(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | pka | 6.32±0.70(Predicted) | | Appearance | White to off-white Solid | | InChI | 1S/C22H17N2.3C4H9.Sn/c1-4-10-19(11-5-1)22(24-17-16-23-18-24,20-12-6-2-7-13-20)21-14-8-3-9-15-21;3*1-3-4-2;/h1-15,17-18H;3*1,3-4H2,2H3; | | InChIKey | WGZVQAZCALOGIM-UHFFFAOYSA-N | | SMILES | CCCC[Sn](CCCC)(CCCC)c1cn(cn1)C(c2ccccc2)(c3ccccc3)c4ccccc4 |
| WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Acute Tox. 4 Dermal
Aquatic Acute 1
Aquatic Chronic 1
Eye Irrit. 2
Repr. 1B
Skin Irrit. 2
STOT RE 1 |
| | 4-(Tributylstannyl)-1-tritylimidazole Usage And Synthesis |
| | 4-(Tributylstannyl)-1-tritylimidazole Preparation Products And Raw materials |
|