| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 6-METHYL-2-(TRIBUTYLSTANNYL)PYRIDINE Basic information |
| Product Name: | 6-METHYL-2-(TRIBUTYLSTANNYL)PYRIDINE | | Synonyms: | 6-METHYL-2-(TRIBUTYLSTANNYL)PYRIDINE;2-Methyl-6-(tri-n-butylstannyl)pyridine, 96%;(6-Methylpyridin-2-yl)tributylstannane;2-Methyl-6-tributylstannanylpyridine;(6-Methylpyridin-2-yl)tributylstannane, 6-(Tributylstannyl)-2-picoline;2-(Tributylstannyl)-6-Methylpyridine;tributyl-(6-methyl-2-pyridyl)stannane;Pyridine, 2-methyl-6-(tributylstannyl)- | | CAS: | 259807-95-9 | | MF: | C18H33NSn | | MW: | 382.17 | | EINECS: | | | Product Categories: | Stannanes | | Mol File: | 259807-95-9.mol |  |
| | 6-METHYL-2-(TRIBUTYLSTANNYL)PYRIDINE Chemical Properties |
| Boiling point | 391.9±44.0 °C(Predicted) | | density | 1.134 g/mL at 25 °C | | refractive index | n20/D1.512 | | Fp | 87℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | liquid | | pka | 5.92±0.19(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | 1S/C6H6N.3C4H9.Sn/c1-6-4-2-3-5-7-6;3*1-3-4-2;/h2-4H,1H3;3*1,3-4H2,2H3; | | InChIKey | USKQYZHWJZDNCM-UHFFFAOYSA-N | | SMILES | CCCC[Sn](CCCC)(CCCC)c1cccc(C)n1 | | CAS DataBase Reference | 259807-95-9 |
| Hazard Codes | T,N | | Risk Statements | 21-25-36/38-48/23/25-50/53 | | Safety Statements | 36/37/39-45-60-61 | | RIDADR | UN 2788 6.1/PG 3 | | WGK Germany | 3 | | HazardClass | 6.1 | | HS Code | 2933399990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Acute Tox. 4 Dermal
Aquatic Acute 1
Aquatic Chronic 1
Eye Irrit. 2
Repr. 1B
Skin Irrit. 2
STOT RE 1 |
| | 6-METHYL-2-(TRIBUTYLSTANNYL)PYRIDINE Usage And Synthesis |
| | 6-METHYL-2-(TRIBUTYLSTANNYL)PYRIDINE Preparation Products And Raw materials |
|