|
|
| | Atorvastatin Cyclic Sodium Salt (Isopropyl) Impurity Basic information |
| | Atorvastatin Cyclic Sodium Salt (Isopropyl) Impurity Chemical Properties |
| Melting point | >150°C (dec.) | | storage temp. | Amber Vial, -20°C Freezer, Under Inert Atmosphere | | solubility | Ethyl Acetate (Slightly), Methanol (Slightly), Water (Slightly) | | form | Solid | | color | White to Off-White | | Stability: | Hygroscopic, Light Sensitive | | InChIKey | WSBFOYJRBIPCLN-UHFFFAOYSA-N | | SMILES | C(C12C3(OC(CC(O)CC(=O)O)CCN3C(C3C=CC(F)=CC=3)(O)C1(C1C=CC=CC=1)O2)C(C)C)(=O)NC1C=CC=CC=1.[NaH] |
| | Atorvastatin Cyclic Sodium Salt (Isopropyl) Impurity Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | A photodegadation product of Atorvastatin (a cyclic impurity of Atorvastatin). |
| | Atorvastatin Cyclic Sodium Salt (Isopropyl) Impurity Preparation Products And Raw materials |
|