|
|
| | (2,3-Dimethylphenyl)[1-(trityl)-1H-imidazol-4-yl]methanone Basic information |
| | (2,3-Dimethylphenyl)[1-(trityl)-1H-imidazol-4-yl]methanone Chemical Properties |
| Melting point | 165 - 171°C | | Boiling point | 593.0±38.0 °C(Predicted) | | density | 1.09 | | storage temp. | 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 1.90±0.61(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C31H26N2O/c1-23-13-12-20-28(24(23)2)30(34)29-21-33(22-32-29)31(25-14-6-3-7-15-25,26-16-8-4-9-17-26)27-18-10-5-11-19-27/h3-22H,1-2H3 | | InChIKey | ZXHLCLMKNSXZEJ-UHFFFAOYSA-N | | SMILES | C(C1=CC=CC(C)=C1C)(C1=CN(C(C2=CC=CC=C2)(C2=CC=CC=C2)C2=CC=CC=C2)C=N1)=O |
| | (2,3-Dimethylphenyl)[1-(trityl)-1H-imidazol-4-yl]methanone Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | (2,3-Dimethylphenyl)[1-(trityl)-1H-imidazol-4-yl]methanone is used in the synthetic preparation of dexmedetomidine from medetomidine intermediate. | | Uses | Intermediate in the production of Medetomidine |
| | (2,3-Dimethylphenyl)[1-(trityl)-1H-imidazol-4-yl]methanone Preparation Products And Raw materials |
|