|
|
| | 4-[(2E)-3-(Dimethylamino)-1-oxo-2-propen-1-yl]benzoic acid methyl ester Basic information |
| Product Name: | 4-[(2E)-3-(Dimethylamino)-1-oxo-2-propen-1-yl]benzoic acid methyl ester | | Synonyms: | Methyl4-[3-(dimethylamino)prop-2-enoyl]benzoate;Benzoic acid, 4-[3-(dimethylamino)-1-oxo-2-propenyl]-, methyl ester,(E)-;enzoic acid, 4-[3-(dimethylamino)-1-oxo-2-propenyl]-, methyl ester,(E)-;4-[(2E)-3-(Dimethylamino)-1-oxo-2-propen-1-yl]benzoic acid methyl ester;methyl 4-[(2E)-3-(dimethylamino)prop-2-enoyl]benzoate;Benzoic acid, 4-[(2E)-3-(dimethylamino)-1-oxo-2-propen-1-yl]-, methyl ester;methyl (E)-4-(3-(dimethylamino)acryloyl)benzoate;Methyl 4-(3-(dimethylamino)acryloyl)benzoate | | CAS: | 114431-72-0 | | MF: | C13H15NO3 | | MW: | 233.26 | | EINECS: | | | Product Categories: | | | Mol File: | 114431-72-0.mol | ![4-[(2E)-3-(Dimethylamino)-1-oxo-2-propen-1-yl]benzoic acid methyl ester Structure](CAS2/GIF/114431-72-0.gif) |
| | 4-[(2E)-3-(Dimethylamino)-1-oxo-2-propen-1-yl]benzoic acid methyl ester Chemical Properties |
| Melting point | 169-171 °C | | Boiling point | 351.435±42.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.114 | | pka | 4.891±0.70(predicted) | | InChI | InChI=1S/C13H15NO3/c1-14(2)9-8-12(15)10-4-6-11(7-5-10)13(16)17-3/h4-9H,1-3H3/b9-8+ | | InChIKey | LRDCVLADWWVIHL-CMDGGOBGSA-N | | SMILES | C(OC)(=O)C1=CC=C(C(=O)/C=C/N(C)C)C=C1 |
| | 4-[(2E)-3-(Dimethylamino)-1-oxo-2-propen-1-yl]benzoic acid methyl ester Usage And Synthesis |
| | 4-[(2E)-3-(Dimethylamino)-1-oxo-2-propen-1-yl]benzoic acid methyl ester Preparation Products And Raw materials |
|