| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
3,5-Dimethyl-2-chloropyridine manufacturers
|
| | 3,5-Dimethyl-2-chloropyridine Basic information | | Application |
| Product Name: | 3,5-Dimethyl-2-chloropyridine | | Synonyms: | 3,5-Dimethyl-2-chloropyridine;2-chloro-3,5-diMethylpyridine;2-Chloro-3,5-lutidine;Pyridine, 2-chloro-3,5-dimethyl-;3,5-Dimethyl-2-chloropyridine ISO 9001:2015 REACH | | CAS: | 72093-12-0 | | MF: | C7H8ClN | | MW: | 141.6 | | EINECS: | | | Product Categories: | | | Mol File: | 72093-12-0.mol |  |
| | 3,5-Dimethyl-2-chloropyridine Chemical Properties |
| storage temp. | Storage temp. 2-8°C | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C7H8ClN/c1-5-3-6(2)7(8)9-4-5/h3-4H,1-2H3 | | InChIKey | FGUVEKFEQISNDB-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC=C(C)C=C1C |
| | 3,5-Dimethyl-2-chloropyridine Usage And Synthesis |
| Application | 3,5-Dimethyl-2-chloropyridine is a heterocyclic derivative and is mainly used as a pharmaceutical intermediate. |
| | 3,5-Dimethyl-2-chloropyridine Preparation Products And Raw materials |
|