| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Diphenylphosphinamide Basic information |
| Product Name: | Diphenylphosphinamide | | Synonyms: | AURORA KA-1558;Diphenylphosphinamide,98%;[Amino(phenyl)phosphoroso]benzene;Diphenyl phosphinic acid amide;[amino(phenyl)phosphoryl]benzene;Phosphinic amide, P,P-diphenyl-;P,P-Diphenylphosphinic amide;Diphenylphosphinamide | | CAS: | 5994-87-6 | | MF: | C12H12NOP | | MW: | 217.2 | | EINECS: | | | Product Categories: | | | Mol File: | 5994-87-6.mol |  |
| | Diphenylphosphinamide Chemical Properties |
| Melting point | 160-162°C | | Boiling point | 368.1±25.0 °C(Predicted) | | density | 1.20±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Soluble in chloroform, nitromethane, nitrobenzene. | | form | solid | | pka | 1.56±0.70(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C12H12NOP/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H,(H2,13,14) | | InChIKey | RIGIWEGXTTUCIQ-UHFFFAOYSA-N | | SMILES | P(C1=CC=CC=C1)(C1=CC=CC=C1)(N)=O |
| Hazard Codes | Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| Provider | Language |
|
ALFA
| English |
| | Diphenylphosphinamide Usage And Synthesis |
| Uses | Diphenylphosphinamide is used to furnish 5H-oxazol-4-ones with diastereoselectivity and enantioselectivity. |
| | Diphenylphosphinamide Preparation Products And Raw materials |
|