| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
|
| | Methyl 3-broMo-2-oxobutanoate Basic information |
| | Methyl 3-broMo-2-oxobutanoate Chemical Properties |
| Boiling point | 193.1±23.0 °C(Predicted) | | density | 1.557±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. -20°C | | form | liquid | | color | Pale yellow | | InChI | InChI=1S/C5H7BrO3/c1-3(6)4(7)5(8)9-2/h3H,1-2H3 | | InChIKey | HYDCQMJFDPQCJH-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C(=O)C(Br)C |
| Hazard Codes | Xn | | Risk Statements | 22-43-52 | | Safety Statements | 36/37 | | WGK Germany | 3 | | HS Code | 2918300090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral Skin Sens. 1 |
| | Methyl 3-broMo-2-oxobutanoate Usage And Synthesis |
| Uses | 3-Bromo-2-oxobutanoic Acid Methyl Ester is an phosphoenolpyruvate analog and have been used to study pyruvate kinase. |
| | Methyl 3-broMo-2-oxobutanoate Preparation Products And Raw materials |
|