|
|
| | Closantel-13C6 Basic information |
| Product Name: | Closantel-13C6 | | Synonyms: | Closantel-13C6;N-{5-Chloro-4-[(4-chlorophenyl)cyanomethyl]-2-methylphenyl}-2-hydroxy-3,5-diiodobenzamide-13C6;Closantel-(benzoyl ring-13C6);13C6-Closantel;Closantel-(benzoyl ring-13C6);Closantel 13C6 (benzoyl ring 13C6) 100 μg/mL in Acetonitrile | | CAS: | 1325559-20-3 | | MF: | C22H14Cl2I2N2O2 | | MW: | 669.03 | | EINECS: | | | Product Categories: | | | Mol File: | 1325559-20-3.mol |  |
| | Closantel-13C6 Chemical Properties |
| density | 1.944±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | Major Application | forensics and toxicology
pharmaceutical (small molecule) | | InChIKey | JMPFSEBWVLAJKM-ZCTWQCQHSA-N | | SMILES | Cc1cc(C(C#N)c2ccc(Cl)cc2)c(Cl)cc1NC(=O)[13c]3[13cH][13c](I)[13cH][13c](I)[13c]3O |
| Hazard Codes | Xn,N | | Risk Statements | 22-50 | | Safety Statements | 61 | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Aquatic Chronic 4 |
| | Closantel-13C6 Usage And Synthesis |
| Uses | Closantel-13C6 is the labeled form of Closantel (C587393), which is potentially useful for studying P-glycoprotein interactions in vitro.Closantel was used in preparation of Closantel-derived bacterial two-component system inhibitors. |
| | Closantel-13C6 Preparation Products And Raw materials |
|