| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 1,3-Dihydroxy-2-propanone 1-phosphate dilithium salt Basic information |
| Product Name: | 1,3-Dihydroxy-2-propanone 1-phosphate dilithium salt | | Synonyms: | 2-Propanone, 1-hydroxy-3-(phosphonooxy)-, dilithium salt;1,3-Dihydroxy-2-propanone 1-phosphate dilithium salt, 1-Hydroxy-3-(phosphonooxy)-2-propanone dilithium salt, DHAP, Glycerone phosphate;DIHYDROXYACETONE PHOSPHATE LITHIUM;DIHYDROXYACETONE PHOSPHATE DILITHIUM;DIHYDROXYACETONE PHOSPHATE DILITHIUM SALT;DIHYDROXYACETONE PHOSPHATE LITHIUM SALT;GLYCERONE PHOSPHATE DILITHIUM SALT;1-HYDROXY-3-(PHOSPHONOOXY)-2-PROPANONE DILITHIUM SALT | | CAS: | 102783-56-2 | | MF: | C3H5Li2O6P | | MW: | 181.92 | | EINECS: | | | Product Categories: | Elisa Kit-plant ELISA Kit | | Mol File: | 102783-56-2.mol |  |
| | 1,3-Dihydroxy-2-propanone 1-phosphate dilithium salt Chemical Properties |
| storage temp. | -20°C | | solubility | H2O: 10 mg/mL, clear, faintly yellow | | form | powder | | color | white | | biological source | bovine (casein) | | Water Solubility | soluble 50mg plus 1ml of H2O, clear, colorless to faintly yellow | | BRN | 1708891 | | InChI | 1S/C3H7O6P.2Li/c4-1-3(5)2-9-10(6,7)8;;/h4H,1-2H2,(H2,6,7,8);;/q;2*+1/p-2 | | InChIKey | QWIKESRFRWLYIA-UHFFFAOYSA-L | | SMILES | [Li+].[Li+].OCC(=O)COP([O-])([O-])=O |
| WGK Germany | 3 | | F | 10-21 | | Storage Class | 11 - Combustible Solids |
| | 1,3-Dihydroxy-2-propanone 1-phosphate dilithium salt Usage And Synthesis |
| Uses | Dihydroxyacetone phosphate (DHAP) is used in fructose metabolism, triose and glycation research. It is used in studies involving the metabolism of three-carbon sugar pools and their roles in physiological and physical processes. DHAP may be used as a substrate to help identify, differentiate and characterize fructose-bisphosphate aldolase(s) (ALDOA) and triosephosphate isomerase(s). DHAP may be used to study cellular glycation stress. | | Biochem/physiol Actions | Dihydroxyacetone phosphate (DHAP) is a metabolic intermediate involved in many pathways, including glycolysis, gluconeogenesis, glycerol metabolism, phosphatidic acid synthesis, fat metabolism, and the Calvin cycle. |
| | 1,3-Dihydroxy-2-propanone 1-phosphate dilithium salt Preparation Products And Raw materials |
|